3-(1,3-Benzothiazol-2-yl)-4-chloroaniline structure
|
Common Name | 3-(1,3-Benzothiazol-2-yl)-4-chloroaniline | ||
|---|---|---|---|---|
| CAS Number | 292644-36-1 | Molecular Weight | 260.742 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 469.4±55.0 °C at 760 mmHg | |
| Molecular Formula | C13H9ClN2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 237.7±31.5 °C | |
| Name | 3-(1,3-benzothiazol-2-yl)-4-chloroaniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 469.4±55.0 °C at 760 mmHg |
| Molecular Formula | C13H9ClN2S |
| Molecular Weight | 260.742 |
| Flash Point | 237.7±31.5 °C |
| Exact Mass | 260.017487 |
| PSA | 67.15000 |
| LogP | 3.68 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.732 |
| InChIKey | GDZBKIWVWVAQEK-UHFFFAOYSA-N |
| SMILES | Nc1ccc(Cl)c(-c2nc3ccccc3s2)c1 |
| HS Code | 2934200090 |
|---|
| HS Code | 2934200090 |
|---|---|
| Summary | 2934200090. other compounds containing in the structure a benzothiazole ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-Benzothiazol-2-yl-4-chloro-phenylamine |
| BEN066 |
| Benzenamine, 3-(2-benzothiazolyl)-4-chloro- |
| 3-(1,3-Benzothiazol-2-yl)-4-chloroaniline |