2-amino-3-[3-(trifluoromethyl)phenyl]sulfanyl-propanoic acid structure
|
Common Name | 2-amino-3-[3-(trifluoromethyl)phenyl]sulfanyl-propanoic acid | ||
|---|---|---|---|---|
| CAS Number | 2928-03-2 | Molecular Weight | 265.25200 | |
| Density | 1.43g/cm3 | Boiling Point | 355.4ºC at 760 mmHg | |
| Molecular Formula | C10H10F3NO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 168.7ºC | |
| Name | 2-amino-3-[3-(trifluoromethyl)phenyl]sulfanylpropanoic acid |
|---|
| Density | 1.43g/cm3 |
|---|---|
| Boiling Point | 355.4ºC at 760 mmHg |
| Molecular Formula | C10H10F3NO2S |
| Molecular Weight | 265.25200 |
| Flash Point | 168.7ºC |
| Exact Mass | 265.03800 |
| PSA | 88.62000 |
| LogP | 2.90970 |
| Vapour Pressure | 1.15E-05mmHg at 25°C |
| Index of Refraction | 1.551 |
| InChIKey | ITDDPZZRKLGDSY-UHFFFAOYSA-N |
| SMILES | NC(CSc1cccc(C(F)(F)F)c1)C(=O)O |
|
~%
2-amino-3-[3-(t... CAS#:2928-03-2 |
| Literature: Goodman et al. Journal of Organic Chemistry, 1958 , vol. 23, p. 1251,1956 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |