L-Alanine,3-[[3-(trifluoromethyl)phenyl]sulfonyl]- structure
|
Common Name | L-Alanine,3-[[3-(trifluoromethyl)phenyl]sulfonyl]- | ||
|---|---|---|---|---|
| CAS Number | 5452-23-3 | Molecular Weight | 297.25100 | |
| Density | 1.513g/cm3 | Boiling Point | 474.1ºC at 760mmHg | |
| Molecular Formula | C10H10F3NO4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 240.5ºC | |
| Name | (2R)-2-amino-3-[3-(trifluoromethyl)phenyl]sulfonylpropanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.513g/cm3 |
|---|---|
| Boiling Point | 474.1ºC at 760mmHg |
| Molecular Formula | C10H10F3NO4S |
| Molecular Weight | 297.25100 |
| Flash Point | 240.5ºC |
| Exact Mass | 297.02800 |
| PSA | 105.84000 |
| LogP | 2.67210 |
| Index of Refraction | 1.519 |
| InChIKey | IHQPYDOZMDDZBC-UHFFFAOYSA-N |
| SMILES | NC(CS(=O)(=O)c1cccc(C(F)(F)F)c1)C(=O)O |
| HS Code | 2922499990 |
|---|
|
~%
L-Alanine,3-[[3... CAS#:5452-23-3 |
| Literature: Goodman et al. Journal of Organic Chemistry, 1958 , vol. 23, p. 1251,1956 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| (R)-2-amino-3-(3-trifluoromethyl-benzenesulfonyl)-propionic acid |
| 2-amino-3-[3-(trifluoromethyl)phenyl]sulfonyl-propanoic acid |
| (R)-2-Amino-3-(3-trifluormethyl-benzolsulfonyl)-propionsaeure |