4-bromo-6-(methoxycarbonyl)picolinic acid structure
|
Common Name | 4-bromo-6-(methoxycarbonyl)picolinic acid | ||
|---|---|---|---|---|
| CAS Number | 293294-72-1 | Molecular Weight | 260.042 | |
| Density | 1.7±0.1 g/cm3 | Boiling Point | 435.6±45.0 °C at 760 mmHg | |
| Molecular Formula | C8H6BrNO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 217.3±28.7 °C | |
| Name | 4-bromo-6-methoxycarbonylpyridine-2-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.7±0.1 g/cm3 |
|---|---|
| Boiling Point | 435.6±45.0 °C at 760 mmHg |
| Molecular Formula | C8H6BrNO4 |
| Molecular Weight | 260.042 |
| Flash Point | 217.3±28.7 °C |
| Exact Mass | 258.947998 |
| PSA | 76.49000 |
| LogP | 0.41 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.595 |
| InChIKey | QCOHUYJZSNJBBC-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cc(Br)cc(C(=O)O)n1 |
| Storage condition | 2-8°C |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-bromo-6-(methoxycarbonyl)pyridine-2-carboxylic nacid |
| 4-bromo-6-(methoxycarbonyl)pyridine-2-carboxylic acid |
| 2,6-Pyridinedicarboxylic acid, 4-bromo-, monomethyl ester |
| 4-Bromo-6-(methoxycarbonyl)picolinic acid |
| 4-Bromo-6-(methoxycarbonyl)-2-pyridinecarboxylic acid |