4-Bromo-6-indolecarboxylic acid structure
|
Common Name | 4-Bromo-6-indolecarboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 374633-27-9 | Molecular Weight | 240.053 | |
| Density | 1.8±0.1 g/cm3 | Boiling Point | 464.9±30.0 °C at 760 mmHg | |
| Molecular Formula | C9H6BrNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 235.0±24.6 °C | |
| Name | 4-bromo-1H-indole-6-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.8±0.1 g/cm3 |
|---|---|
| Boiling Point | 464.9±30.0 °C at 760 mmHg |
| Molecular Formula | C9H6BrNO2 |
| Molecular Weight | 240.053 |
| Flash Point | 235.0±24.6 °C |
| Exact Mass | 238.958176 |
| PSA | 53.09000 |
| LogP | 2.63 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.749 |
| InChIKey | SAEJTFXNRYRHNA-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cc(Br)c2cc[nH]c2c1 |
| Hazard Codes | Xn |
|---|---|
| HS Code | 2933990090 |
|
~%
4-Bromo-6-indol... CAS#:374633-27-9 |
| Literature: WO2006/101937 A1, ; Page/Page column 39 ; WO 2006/101937 A1 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-Bromo-6-indolecarboxylic acid |
| 4-Bromo-1H-indole-6-carboxylic acid |
| 1H-Indole-6-carboxylic acid, 4-bromo- |
| 4-Bromoindole-6-carboxylic acid |