(Z)-N-(carboxymethyl)-N-(1-oxo-9-octadecenyl)glycine structure
|
Common Name | (Z)-N-(carboxymethyl)-N-(1-oxo-9-octadecenyl)glycine | ||
|---|---|---|---|---|
| CAS Number | 29332-74-9 | Molecular Weight | 397.54900 | |
| Density | 1.049g/cm3 | Boiling Point | 581.2ºC at 760mmHg | |
| Molecular Formula | C22H39NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 305.3ºC | |
| Name | 2-[carboxymethyl(octadec-9-enoyl)amino]acetic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.049g/cm3 |
|---|---|
| Boiling Point | 581.2ºC at 760mmHg |
| Molecular Formula | C22H39NO5 |
| Molecular Weight | 397.54900 |
| Flash Point | 305.3ºC |
| Exact Mass | 397.28300 |
| PSA | 94.91000 |
| LogP | 5.02170 |
| Vapour Pressure | 5.11E-15mmHg at 25°C |
| Index of Refraction | 1.497 |
| InChIKey | NOYJVHLJXVQHFO-KTKRTIGZSA-N |
| SMILES | CCCCCCCCC=CCCCCCCCC(=O)N(CC(=O)O)CC(=O)O |
|
~51%
(Z)-N-(carboxym... CAS#:29332-74-9 |
| Literature: Osornio, Yazmin M.; Uebelhart, Peter; Bosshard, Silvan; Konrad, Fabian; Siegel, Jay S.; Landau, Ehud M. Journal of Organic Chemistry, 2012 , vol. 77, # 23 p. 10583 - 10595 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| N-Oleoyliminodiacetic acid |