WAY-298844 structure
|
Common Name | WAY-298844 | ||
|---|---|---|---|---|
| CAS Number | 293326-29-1 | Molecular Weight | 295.33 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 496.2±45.0 °C at 760 mmHg | |
| Molecular Formula | C18H17NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 253.9±28.7 °C | |
Use of WAY-298844Androgen Receptor modulator |
| Name | WAY-298844 |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 496.2±45.0 °C at 760 mmHg |
| Molecular Formula | C18H17NO3 |
| Molecular Weight | 295.33 |
| Flash Point | 253.9±28.7 °C |
| Exact Mass | 295.120850 |
| LogP | 2.15 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Index of Refraction | 1.663 |
| InChIKey | MEDXQOPMFHGNRT-UHFFFAOYSA-N |
| SMILES | COCCCN1C(=O)c2ccc3c4c(ccc(c24)C1=O)CC3 |
| 1H-Indeno[6,7,1-def]isoquinoline-1,3(2H)-dione, 6,7-dihydro-2-(3-methoxypropyl)- |
| 6-(3-Methoxy-propyl)-1,2-dihydro-6-aza-cyclopenta[cd]phenalene-5,7-dione |
| 2-(3-Methoxypropyl)-6,7-dihydro-1H-indeno[6,7,1-def]isoquinoline-1,3(2H)-dione |