1-Nitro-3-(phenylethynyl)benzene
1-Nitro-3-(phenylethynyl)benzene structure
|
Common Name | 1-Nitro-3-(phenylethynyl)benzene | ||
|---|---|---|---|---|
| CAS Number | 29338-47-4 | Molecular Weight | 223.22700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H9NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-nitro-3-(2-phenylethynyl)benzene |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H9NO2 |
|---|---|
| Molecular Weight | 223.22700 |
| Exact Mass | 223.06300 |
| PSA | 45.82000 |
| LogP | 3.51780 |
| InChIKey | WIDIJEWZZQPARQ-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cccc(C#Cc2ccccc2)c1 |
| Storage condition | 2-8°C |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 10 | |
|---|---|
| DownStream 1 | |
CAS#:645-00-1
CAS#:536-74-3
CAS#:585-79-5
CAS#:1719-19-3
CAS#:3757-88-8
CAS#:13146-23-1
CAS#:13331-27-6
CAS#:637-44-5
CAS#:586-36-7
CAS#:32584-71-7
CAS#:51624-44-3This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| MFCD00445281 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of 1-nitro-3-(2-phenylethynyl)benzene? |
| A: LogP of 1-nitro-3-(2-phenylethynyl)benzene is 3.51780. |
| Q: What is the molecular weight of 1-nitro-3-(2-phenylethynyl)benzene? |
| A: Molecular weight of 1-nitro-3-(2-phenylethynyl)benzene is 223.22700. |
| Q: What is the CAS number of 1-nitro-3-(2-phenylethynyl)benzene? |
| A: CAS number of 1-nitro-3-(2-phenylethynyl)benzene is 29338-47-4. |
| Q: What is the English name of 1-nitro-3-(2-phenylethynyl)benzene? |
| A: The English name of 1-nitro-3-(2-phenylethynyl)benzene is 1-nitro-3-(2-phenylethynyl)benzene. |
| Q: What are the upstream materials of 1-nitro-3-(2-phenylethynyl)benzene? |
| A: Related upstream materials(CAS) of 1-nitro-3-(2-phenylethynyl)benzene: 645-00-1;536-74-3;585-79-5;1719-19-3;3757-88-8;13146-23-1;13331-27-6;637-44-5;586-36-7;32584-71-7. |
| Q: What is the SMILES notation of 1-nitro-3-(2-phenylethynyl)benzene? |
| A: SMILES notation of 1-nitro-3-(2-phenylethynyl)benzene is O=[N+]([O-])c1cccc(C#Cc2ccccc2)c1. |
| Q: What are the downstream products of 1-nitro-3-(2-phenylethynyl)benzene? |
| A: Related downstream products(CAS) of 1-nitro-3-(2-phenylethynyl)benzene: 51624-44-3. |
| Q: What are the storage conditions for 1-nitro-3-(2-phenylethynyl)benzene? |
| A: Storage conditions for 1-nitro-3-(2-phenylethynyl)benzene: 2-8°C. |
| Q: What is the molecular formula of 1-nitro-3-(2-phenylethynyl)benzene? |
| A: Molecular formula of 1-nitro-3-(2-phenylethynyl)benzene is C14H9NO2. |
| Q: What is the InChIKey of 1-nitro-3-(2-phenylethynyl)benzene? |
| A: InChIKey of 1-nitro-3-(2-phenylethynyl)benzene is WIDIJEWZZQPARQ-UHFFFAOYSA-N. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |