1,4-Naphthalenedione,2-hydroxy-3-(1-propen-1-yl) structure
|
Common Name | 1,4-Naphthalenedione,2-hydroxy-3-(1-propen-1-yl) | ||
|---|---|---|---|---|
| CAS Number | 29366-41-4 | Molecular Weight | 214.21700 | |
| Density | 1.414g/cm3 | Boiling Point | 393.2ºC at 760mmHg | |
| Molecular Formula | C13H10O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 205.8ºC | |
| Name | 4-hydroxy-3-[(E)-prop-1-enyl]naphthalene-1,2-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.414g/cm3 |
|---|---|
| Boiling Point | 393.2ºC at 760mmHg |
| Molecular Formula | C13H10O3 |
| Molecular Weight | 214.21700 |
| Flash Point | 205.8ºC |
| Exact Mass | 214.06300 |
| PSA | 54.37000 |
| LogP | 2.45380 |
| Vapour Pressure | 6.88E-07mmHg at 25°C |
| Index of Refraction | 1.726 |
| InChIKey | MFNVTOPBJXIFMN-GORDUTHDSA-N |
| SMILES | CC=CC1=C(O)c2ccccc2C(=O)C1=O |
| HS Code | 2914690090 |
|---|
|
~48%
1,4-Naphthalene... CAS#:29366-41-4 |
| Literature: Glazunov; Berdyshev; Yakubovskaya; Pokhilo Russian Chemical Bulletin, 2006 , vol. 55, # 10 p. 1729 - 1736 |
|
~%
1,4-Naphthalene... CAS#:29366-41-4 |
| Literature: Hooker Journal of the American Chemical Society, 1936 , vol. 58, p. 1174,1178 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2914690090 |
|---|---|
| Summary | 2914690090 other quinones。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
|
Name: Evaluated for cytotoxicity in the KB cell culture assay
Source: ChEMBL
Target: KB
External Id: CHEMBL703149
|
| 1,4-Naphthoquinone,2-hydroxy-3-propenyl |
| 1,2-hydroxy-3-propenyl |