5-Nitro-3-phenyl-1H-indazole structure
|
Common Name | 5-Nitro-3-phenyl-1H-indazole | ||
|---|---|---|---|---|
| CAS Number | 293758-67-5 | Molecular Weight | 239.22900 | |
| Density | 1.389g/cm3 | Boiling Point | 491.8ºC at 760 mmHg | |
| Molecular Formula | C13H9N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 251.2ºC | |
| Name | 5-Nitro-3-phenyl-1H-indazole |
|---|
| Density | 1.389g/cm3 |
|---|---|
| Boiling Point | 491.8ºC at 760 mmHg |
| Molecular Formula | C13H9N3O2 |
| Molecular Weight | 239.22900 |
| Flash Point | 251.2ºC |
| Exact Mass | 239.06900 |
| PSA | 74.50000 |
| LogP | 3.66130 |
| Vapour Pressure | 2.44E-09mmHg at 25°C |
| Index of Refraction | 1.716 |
| InChIKey | XTLYDYMVKAGVIN-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc2[nH]nc(-c3ccccc3)c2c1 |
| HS Code | 2933990090 |
|---|
|
~93%
5-Nitro-3-pheny... CAS#:293758-67-5 |
| Literature: US2004/127536 A1, ; |
|
~%
5-Nitro-3-pheny... CAS#:293758-67-5 |
| Literature: Justus Liebigs Annalen der Chemie, , vol. 540, p. 83,96 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |