2-Chloro-5-nitrobenzophenone structure
|
Common Name | 2-Chloro-5-nitrobenzophenone | ||
|---|---|---|---|---|
| CAS Number | 34052-37-4 | Molecular Weight | 261.660 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 407.7±30.0 °C at 760 mmHg | |
| Molecular Formula | C13H8ClNO3 | Melting Point | 83-85 °C(lit.) | |
| MSDS | USA | Flash Point | 200.4±24.6 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 2-Chloro-5-nitrobenzophenone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 407.7±30.0 °C at 760 mmHg |
| Melting Point | 83-85 °C(lit.) |
| Molecular Formula | C13H8ClNO3 |
| Molecular Weight | 261.660 |
| Flash Point | 200.4±24.6 °C |
| Exact Mass | 261.019257 |
| PSA | 62.89000 |
| LogP | 3.24 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.623 |
| InChIKey | HRPHZUAPQWJPCZ-UHFFFAOYSA-N |
| SMILES | O=C(c1ccccc1)c1cc([N+](=O)[O-])ccc1Cl |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H319 |
| Precautionary Statements | P305 + P351 + P338 |
| Personal Protective Equipment | Eyeshields;Gloves |
| Hazard Codes | N:Dangerousfortheenvironment; |
| Risk Phrases | R51/53 |
| Safety Phrases | S61 |
| RIDADR | UN 3077 9/PG 3 |
| WGK Germany | 3 |
| HS Code | 2914700090 |
| Precursor 3 | |
|---|---|
| DownStream 6 | |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
|
Synthesis of 13C-and 14C-labelled catechol. Ji R and Schäffer A.
J. Labelled Comp. Radiopharm. 45(7) , 551-558, (2002)
|
|
|
Synthesis and characterization of aromatic poly (ether sulfone) s with pendent benzoyl groups. Eom HJ and Kim SY.
Polym. Bull. 41(6) , 631-637, (1998)
|
| 2-chloro-5-nitrophenyl phenyl ketone |
| 2-Chlor-5-nitro-benzophenon |
| 5-Nitro-2-chlorobenzophenone |
| EINECS 251-811-3 |
| MFCD00007295 |
| 2-Chloro-5-nitrobenzophenone |
| 2-chloro-5-nitro-benzophenone |
| (2-Chloro-5-nitrophenyl)(phenyl)methanone |
| Methanone, (2-chloro-5-nitrophenyl)phenyl- |