Benzenepentanoic acid, a,a-dimethyl-d-oxo-
Modify Date: 2025-08-25 12:41:36
Benzenepentanoic acid, a,a-dimethyl-d-oxo- structure
|
Common Name | Benzenepentanoic acid, a,a-dimethyl-d-oxo- | ||
|---|---|---|---|---|
| CAS Number | 2938-49-0 | Molecular Weight | 220.26400 | |
| Density | 1.111g/cm3 | Boiling Point | 386.6ºC at 760 mmHg | |
| Molecular Formula | C13H16O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 201.8ºC | |
| Name | 2,2-dimethyl-5-oxo-5-phenylpentanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.111g/cm3 |
|---|---|
| Boiling Point | 386.6ºC at 760 mmHg |
| Molecular Formula | C13H16O3 |
| Molecular Weight | 220.26400 |
| Flash Point | 201.8ºC |
| Exact Mass | 220.11000 |
| PSA | 54.37000 |
| LogP | 2.76030 |
| Vapour Pressure | 1.15E-06mmHg at 25°C |
| Index of Refraction | 1.527 |
| InChIKey | GFSBTKQESZRYHB-UHFFFAOYSA-N |
| SMILES | CC(C)(CCC(=O)c1ccccc1)C(=O)O |
|
~%
Benzenepentanoi... CAS#:2938-49-0 |
| Literature: Gautam, R. K.; Kannan, S.; Saharia, G. S. Journal of the Indian Chemical Society, 1982 , vol. 59, # 3 p. 378 - 379 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 4-Benzoyl-2,2-dimethyl-buttersaeure |
| 2.2-Dimethyl-4-benzoylbuttersaeure |