Benzenepentanoic acid, g,g-dimethyl-d-oxo- structure
|
Common Name | Benzenepentanoic acid, g,g-dimethyl-d-oxo- | ||
|---|---|---|---|---|
| CAS Number | 2938-68-3 | Molecular Weight | 220.26400 | |
| Density | 1.111g/cm3 | Boiling Point | 386.6ºC at 760mmHg | |
| Molecular Formula | C13H16O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 201.8ºC | |
| Name | 4,4-dimethyl-5-oxo-5-phenylpentanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.111g/cm3 |
|---|---|
| Boiling Point | 386.6ºC at 760mmHg |
| Molecular Formula | C13H16O3 |
| Molecular Weight | 220.26400 |
| Flash Point | 201.8ºC |
| Exact Mass | 220.11000 |
| PSA | 54.37000 |
| LogP | 2.76030 |
| Vapour Pressure | 1.15E-06mmHg at 25°C |
| Index of Refraction | 1.527 |
| InChIKey | LXKOAWNQKIDILE-UHFFFAOYSA-N |
| SMILES | CC(C)(CCC(=O)O)C(=O)c1ccccc1 |
|
~%
Benzenepentanoi... CAS#:2938-68-3 |
| Literature: Johnson,R.N.; Riggs,N.V. Australian Journal of Chemistry, 1971 , vol. 24, p. 1643 - 1658 |
|
~%
Benzenepentanoi... CAS#:2938-68-3 |
| Literature: Johnson,R.N.; Riggs,N.V. Australian Journal of Chemistry, 1971 , vol. 24, p. 1643 - 1658 |
|
~%
Benzenepentanoi... CAS#:2938-68-3 |
| Literature: Haller; Bauer Comptes Rendus Hebdomadaires des Seances de l'Academie des Sciences, 1911 , vol. 153, p. 150 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 4-Benzoyl-4,4-dimethyl butanoic acid |
| 4,4-Dimethyl-5-oxo-5-phenyl-valeriansaeure |
| 4-Benzoyl-4-methylpentansaeure |
| 4,4-dimethyl-5-oxo-5-phenyl-valeric acid |