bis(2,6-dimethylphenyl)diazene structure
|
Common Name | bis(2,6-dimethylphenyl)diazene | ||
|---|---|---|---|---|
| CAS Number | 29418-31-3 | Molecular Weight | 238.32800 | |
| Density | 0.99g/cm3 | Boiling Point | 386.5ºC at 760 mmHg | |
| Molecular Formula | C16H18N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 180ºC | |
| Name | bis(2,6-dimethylphenyl)diazene |
|---|---|
| Synonym | More Synonyms |
| Density | 0.99g/cm3 |
|---|---|
| Boiling Point | 386.5ºC at 760 mmHg |
| Molecular Formula | C16H18N2 |
| Molecular Weight | 238.32800 |
| Flash Point | 180ºC |
| Exact Mass | 238.14700 |
| PSA | 24.72000 |
| LogP | 5.33560 |
| Vapour Pressure | 7.82E-06mmHg at 25°C |
| Index of Refraction | 1.553 |
| InChIKey | XBEAJNFYXLTYFG-UHFFFAOYSA-N |
| SMILES | Cc1cccc(C)c1N=Nc1c(C)cccc1C |
| HS Code | 2927000090 |
|---|
|
~94%
bis(2,6-dimethy... CAS#:29418-31-3 |
| Literature: Noureldin, Nazih A.; Bellegarde, Jody W. Synthesis, 1999 , # 6 p. 939 - 942 |
|
~86%
bis(2,6-dimethy... CAS#:29418-31-3 |
| Literature: Li, Xiaochuan; Wang, Yulu; Wang, Jinye Indian Journal of Chemistry - Section B Organic and Medicinal Chemistry, 2004 , vol. 43, # 3 p. 677 - 678 |
|
~69%
bis(2,6-dimethy... CAS#:29418-31-3 |
| Literature: Barba, Fructuoso; Batanero, Belen; Tissaoui, Khalil; Raouafi, Noureddine; Boujlel, Khaled Electrochemistry Communications, 2010 , vol. 12, # 7 p. 973 - 976 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2927000090 |
|---|---|
| Summary | 2927000090 other diazo-, azo- or azoxy-compounds。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 2,2',6,6'-Tetramethylazobenzene |
| 2,6,2',6'-Tetramethyl-azobenzol |
| 2,2',6,6'-Tetramethyl-azobenzol |