[7,7-dimethyl-3-(2-sulfanylidene-1,3-dioxolan-4-yl)-2,6,8-trioxabicyclo[3.3.0]oct-4-yl] acetate structure
|
Common Name | [7,7-dimethyl-3-(2-sulfanylidene-1,3-dioxolan-4-yl)-2,6,8-trioxabicyclo[3.3.0]oct-4-yl] acetate | ||
|---|---|---|---|---|
| CAS Number | 2946-02-3 | Molecular Weight | 304.31600 | |
| Density | 1.42g/cm3 | Boiling Point | 357.2ºC at 760 mmHg | |
| Molecular Formula | C12H16O7S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 169.8ºC | |
| Name | [2,2-dimethyl-5-(2-sulfanylidene-1,3-dioxolan-4-yl)-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.42g/cm3 |
|---|---|
| Boiling Point | 357.2ºC at 760 mmHg |
| Molecular Formula | C12H16O7S |
| Molecular Weight | 304.31600 |
| Flash Point | 169.8ºC |
| Exact Mass | 304.06200 |
| PSA | 104.54000 |
| LogP | 0.49480 |
| Vapour Pressure | 2.78E-05mmHg at 25°C |
| Index of Refraction | 1.56 |
| InChIKey | LASRVJJVNCSBHU-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1C(C2COC(=S)O2)OC2OC(C)(C)OC21 |
|
~96%
[7,7-dimethyl-3... CAS#:2946-02-3 |
| Literature: Tsuda, Yoshisuke; Sato, Yoshiyuki; Kanemitsu, Kimihiro; Hosoi, Shinzo; Shibayama, Kenji; Nakao, Kayo; Ishikawa, Yuko Chemical and Pharmaceutical Bulletin, 1996 , vol. 44, # 8 p. 1465 - 1475 |
|
~%
[7,7-dimethyl-3... CAS#:2946-02-3 |
| Literature: Tsuda, Yoshisuke; Sato, Yoshiyuki; Kanemitsu, Kimihiro; Hosoi, Shinzo; Shibayama, Kenji; Nakao, Kayo; Ishikawa, Yuko Chemical and Pharmaceutical Bulletin, 1996 , vol. 44, # 8 p. 1465 - 1475 |
| 2,2-dimethyl-5-(2-thioxo-1,3-dioxolan-4-yl)tetrahydrofuro[2,3-d][1,3]dioxol-6-yl acetate(non-preferred name) |