8-Bromoadenosine structure
|
Common Name | 8-Bromoadenosine | ||
|---|---|---|---|---|
| CAS Number | 2946-39-6 | Molecular Weight | 346.14 | |
| Density | 2.5±0.1 g/cm3 | Boiling Point | 717.7±70.0 °C at 760 mmHg | |
| Molecular Formula | C10H12BrN5O4 | Melting Point | 210-212 °C (dec.)(lit.) | |
| MSDS | USA | Flash Point | 387.8±35.7 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
Use of 8-Bromoadenosine8-Bromoadenosine is an adenosine analog. Adenosine analogs mostly act as smooth muscle vasodilators and have also been shown to inhibit cancer progression. Its popular products are adenosine phosphate, Acadesine (HY-13417), Clofarabine (HY-A0005), Fludarabine phosphate (HY-B0028) and Vidarabine (HY-B0277)[1]. |
| Name | 8-bromoadenosine |
|---|---|
| Synonym | More Synonyms |
| Description | 8-Bromoadenosine is an adenosine analog. Adenosine analogs mostly act as smooth muscle vasodilators and have also been shown to inhibit cancer progression. Its popular products are adenosine phosphate, Acadesine (HY-13417), Clofarabine (HY-A0005), Fludarabine phosphate (HY-B0028) and Vidarabine (HY-B0277)[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 2.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 717.7±70.0 °C at 760 mmHg |
| Melting Point | 210-212 °C (dec.)(lit.) |
| Molecular Formula | C10H12BrN5O4 |
| Molecular Weight | 346.14 |
| Flash Point | 387.8±35.7 °C |
| Exact Mass | 345.007263 |
| PSA | 139.54000 |
| LogP | -0.30 |
| Vapour Pressure | 0.0±2.4 mmHg at 25°C |
| Index of Refraction | 1.941 |
| InChIKey | VJUPMOPLUQHMLE-UUOKFMHZSA-N |
| SMILES | Nc1ncnc2c1nc(Br)n2C1OC(CO)C(O)C1O |
| Storage condition | 2-8°C |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36-S24/25-S22 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
|
~82%
8-Bromoadenosine CAS#:2946-39-6 |
| Literature: European Journal of Organic Chemistry, , # 10 p. 1515 - 1521 |
|
~46%
8-Bromoadenosine CAS#:2946-39-6 |
| Literature: US2013/72506 A1, ; Paragraph 0128 ; |
|
~%
8-Bromoadenosine CAS#:2946-39-6 |
| Literature: US2003/8841 A1, ; |
|
~%
8-Bromoadenosine CAS#:2946-39-6 |
| Literature: US2003/8841 A1, ; |
|
~%
8-Bromoadenosine CAS#:2946-39-6 |
| Literature: US2003/8841 A1, ; |
|
~%
8-Bromoadenosine CAS#:2946-39-6 |
| Literature: US2003/8841 A1, ; |
|
~%
8-Bromoadenosine CAS#:2946-39-6 |
| Literature: US2003/8841 A1, ; |
|
PKA signaling drives mammary tumorigenesis through Src.
Oncogene 34(9) , 1160-73, (2015) Protein kinase A (PKA) hyperactivation causes hereditary endocrine neoplasias; however, its role in sporadic epithelial cancers is unknown. Here, we show that heightened PKA activity in the mammary ep... |
|
|
ADAM12-directed ectodomain shedding of E-cadherin potentiates trophoblast fusion.
Cell Death Differ. 22 , 1970-84, (2015) Trophoblasts, placental cells of epithelial lineage, undergo extensive differentiation to form the cellular components of the placenta. Trophoblast progenitor cell differentiation into the multinuclea... |
|
|
Prostaglandin E2 Inhibits NLRP3 Inflammasome Activation through EP4 Receptor and Intracellular Cyclic AMP in Human Macrophages.
J. Immunol. 194 , 5472-87, (2015) PGE2 is a potent lipid mediator involved in maintaining homeostasis but also promotion of acute inflammation or immune suppression in chronic inflammation and cancer. Nucleotide-binding domain, leucin... |
| 8-Br-A |
| 8-Bromoadenine-9-β-D-ribofuranoside |
| 8-Bromoadenosine |
| (2R,3R,4S,5R)-2-(6-Amino-8-bromo-9H-purin-9-yl)-5-(hydroxymethyl)tetrahydrofuran-3,4-diol |
| Adenosine, 8-bromo- |
| 8-BROMO-D-ADENOSINE |
| 6-AMINO-8-BROMOPURINE RIBOSIDE |
| 8-bromo-adenosine |
| MFCD00005733 |
| EINECS 220-959-0 |