Methyl 3-(3-bromophenyl)-3-oxopropanoate structure
|
Common Name | Methyl 3-(3-bromophenyl)-3-oxopropanoate | ||
|---|---|---|---|---|
| CAS Number | 294881-10-0 | Molecular Weight | 257.081 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 314.2±22.0 °C at 760 mmHg | |
| Molecular Formula | C10H9BrO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 143.8±22.3 °C | |
| Name | methyl 3-(3-bromophenyl)-3-oxopropanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 314.2±22.0 °C at 760 mmHg |
| Molecular Formula | C10H9BrO3 |
| Molecular Weight | 257.081 |
| Flash Point | 143.8±22.3 °C |
| Exact Mass | 255.973495 |
| PSA | 43.37000 |
| LogP | 2.25 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.546 |
| InChIKey | ARQSZPQWKHRYTH-UHFFFAOYSA-N |
| SMILES | COC(=O)CC(=O)c1cccc(Br)c1 |
| HS Code | 2918300090 |
|---|
|
~96%
Methyl 3-(3-bro... CAS#:294881-10-0 |
| Literature: Balamurugan, Rengarajan; Manojveer, Seetharaman Chemical Communications, 2011 , vol. 47, # 39 p. 11143 - 11145 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| Benzenepropanoic acid, 3-bromo-β-oxo-, methyl ester |
| Methyl 3-(3-bromophenyl)-3-oxopropanoate |
| 3-Bromo-b-oxo-benzenepropanoic acid methyl ester |