Methyl 3-(3-chlorophenyl)-3-oxopropanoate structure
|
Common Name | Methyl 3-(3-chlorophenyl)-3-oxopropanoate | ||
|---|---|---|---|---|
| CAS Number | 632327-19-6 | Molecular Weight | 212.630 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 297.3±20.0 °C at 760 mmHg | |
| Molecular Formula | C10H9ClO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 124.6±20.8 °C | |
| Name | methyl 3-(3-chlorophenyl)-3-oxopropanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 297.3±20.0 °C at 760 mmHg |
| Molecular Formula | C10H9ClO3 |
| Molecular Weight | 212.630 |
| Flash Point | 124.6±20.8 °C |
| Exact Mass | 212.024017 |
| PSA | 43.37000 |
| LogP | 2.18 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.529 |
| InChIKey | MDZSDWBDIPJXKR-UHFFFAOYSA-N |
| SMILES | COC(=O)CC(=O)c1cccc(Cl)c1 |
| HS Code | 2918300090 |
|---|
|
~95%
Methyl 3-(3-chl... CAS#:632327-19-6 |
| Literature: Reddy, K. Raja; Erion, Mark D.; Matelich, Michael C.; Kopcho, Joseph J. Patent: US2003/229225 A1, 2003 ; Location in patent: Page 18 ; |
|
~%
Methyl 3-(3-chl... CAS#:632327-19-6 |
| Literature: Reddy, K. Raja; Erion, Mark D. Patent: US2005/182252 A1, 2005 ; Location in patent: Page/Page column 38-39 ; |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 3-(3-Chlor-phenyl)-3-oxo-propionsaeure-methylester |
| 3-(3-Chloro-phenyl)-3-oxo-propionic acid methyl ester |
| methyl 3-(3'-chlorophenyl)-3-oxo-propanoate |
| Methyl 3-(3-chlorophenyl)-3-oxopropanoate |
| methyl 3-(3'-chlorophenyl)-3-oxo-propionate |
| 3-Chlor-benzoylessigsaeure-methylester |
| Benzenepropanoic acid, 3-chloro-β-oxo-, methyl ester |
| 3-oxo-3-(3-chloro-phenyl)-propionic acid methyl ester |
| 3-Chloro-b-oxo-benzenepropanoic acid methyl ester |