2,2-dichloro-N-[10-[(2,2-dichloroacetyl)-ethyl-amino]decyl]-N-ethyl-ac etamide structure
|
Common Name | 2,2-dichloro-N-[10-[(2,2-dichloroacetyl)-ethyl-amino]decyl]-N-ethyl-ac etamide | ||
|---|---|---|---|---|
| CAS Number | 29524-19-4 | Molecular Weight | 450.27100 | |
| Density | 1.182g/cm3 | Boiling Point | 502.8ºC at 760mmHg | |
| Molecular Formula | C18H32Cl4N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 257.9ºC | |
| Name | 2,2-dichloro-N-[10-[(2,2-dichloroacetyl)-ethylamino]decyl]-N-ethylacetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.182g/cm3 |
|---|---|
| Boiling Point | 502.8ºC at 760mmHg |
| Molecular Formula | C18H32Cl4N2O2 |
| Molecular Weight | 450.27100 |
| Flash Point | 257.9ºC |
| Exact Mass | 448.12200 |
| PSA | 40.62000 |
| LogP | 5.41160 |
| Vapour Pressure | 3.06E-10mmHg at 25°C |
| Index of Refraction | 1.501 |
| InChIKey | GHXBCRVFHMQZEB-UHFFFAOYSA-N |
| SMILES | CCN(CCCCCCCCCCN(CC)C(=O)C(Cl)Cl)C(=O)C(Cl)Cl |
| HS Code | 2924199090 |
|---|
|
~%
2,2-dichloro-N-... CAS#:29524-19-4 |
| Literature: Surrey,A.R.; Mayer,J.R. Journal of Medicinal and Pharmaceutical Chemistry, 1961 , vol. 3, p. 419 - 425 |
|
~%
2,2-dichloro-N-... CAS#:29524-19-4 |
| Literature: Surrey,A.R.; Mayer,J.R. Journal of Medicinal and Pharmaceutical Chemistry, 1961 , vol. 3, p. 419 - 425 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924199090 |
|---|---|
| Summary | 2924199090. other acyclic amides (including acyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| ls-8791 |