5-(diethylaminomethyl)-2-methylfuran-3-carboxylic acid
Modify Date: 2025-11-04 18:02:28
5-(diethylaminomethyl)-2-methylfuran-3-carboxylic acid structure
|
Common Name | 5-(diethylaminomethyl)-2-methylfuran-3-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 296274-15-2 | Molecular Weight | 211.25800 | |
| Density | 1.108g/cm3 | Boiling Point | 305.1ºC at 760 mmHg | |
| Molecular Formula | C11H17NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 138.3ºC | |
| Name | 5-(diethylaminomethyl)-2-methylfuran-3-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.108g/cm3 |
|---|---|
| Boiling Point | 305.1ºC at 760 mmHg |
| Molecular Formula | C11H17NO3 |
| Molecular Weight | 211.25800 |
| Flash Point | 138.3ºC |
| Exact Mass | 211.12100 |
| PSA | 53.68000 |
| LogP | 2.12800 |
| Vapour Pressure | 0.000368mmHg at 25°C |
| Index of Refraction | 1.514 |
| InChIKey | BTWYDFQXKGAWDB-UHFFFAOYSA-N |
| SMILES | CCN(CC)Cc1cc(C(=O)O)c(C)o1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2932190090 |
| HS Code | 2932190090 |
|---|---|
| Summary | 2932190090 other compounds containing an unfused furan ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| 5-[(diethylamino)methyl]-2-methylfuran-3-carboxylic acid |