1,3-Bis[(2H3)methyl]benzene
Modify Date: 2025-08-22 21:14:45
![1,3-Bis[(2H3)methyl]benzene Structure](https://image.chemsrc.com/caspic/302/29636-65-5.png)
1,3-Bis[(2H3)methyl]benzene structure
|
Common Name | 1,3-Bis[(2H3)methyl]benzene | ||
|---|---|---|---|---|
| CAS Number | 29636-65-5 | Molecular Weight | 112.202 | |
| Density | 0.9±0.1 g/cm3 | Boiling Point | 140.6±10.0 °C at 760 mmHg | |
| Molecular Formula | C8H4D6 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 25.0±0.0 °C | |
| Symbol |
GHS02, GHS07 |
Signal Word | Warning | |
| Name | 1,3-bis(trideuteriomethyl)benzene |
|---|---|
| Synonym | More Synonyms |
| Density | 0.9±0.1 g/cm3 |
|---|---|
| Boiling Point | 140.6±10.0 °C at 760 mmHg |
| Molecular Formula | C8H4D6 |
| Molecular Weight | 112.202 |
| Flash Point | 25.0±0.0 °C |
| Exact Mass | 112.115913 |
| LogP | 3.14 |
| Vapour Pressure | 7.6±0.1 mmHg at 25°C |
| Index of Refraction | 1.500 |
| InChIKey | IVSZLXZYQVIEFR-WFGJKAKNSA-N |
| SMILES | [2H]C([2H])([2H])C1=CC(=CC=C1)C([2H])([2H])[2H] |
| Symbol |
GHS02, GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H226-H312-H315-H332 |
| Precautionary Statements | P280 |
| RIDADR | UN1307 - class 3 - PG 3 - Xylenes |
|
~%
1,3-Bis[(2H3)me... CAS#:29636-65-5 |
| Literature: Renaud; Leitch Canadian Journal of Chemistry, 1956 , vol. 34, p. 98,101 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 1,3-Bis-trideuteriomethyl-benzol |
| 1,3-Dimethyl-d6-benzene |
| 1,3-Bis[(H)methyl]benzene |
| 1,3-bis-trideuteriomethyl-benzene |
| m-xylene-d6 |