1,3-Bis[(2H3)methyl]benzene
![1,3-Bis[(2H3)methyl]benzene Structure](https://image.chemsrc.com/caspic/302/29636-65-5.png)
1,3-Bis[(2H3)methyl]benzene structure
|
Common Name | 1,3-Bis[(2H3)methyl]benzene | ||
|---|---|---|---|---|
| CAS Number | 29636-65-5 | Molecular Weight | 112.202 | |
| Density | 0.9±0.1 g/cm3 | Boiling Point | 140.6±10.0 °C at 760 mmHg | |
| Molecular Formula | C8H4D6 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 25.0±0.0 °C | |
| Symbol |
GHS02, GHS07 |
Signal Word | Warning | |
Summary: 1,3-bis(trideuteriomethyl)benzene (间二甲苯-D6) with CAS number 29636-65-5 has a molecular formula of C8H4D6 and a molecular weight of 112.202. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1,3-bis(trideuteriomethyl)benzene |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 0.9±0.1 g/cm3 |
|---|---|
| Boiling Point | 140.6±10.0 °C at 760 mmHg |
| Molecular Formula | C8H4D6 |
| Molecular Weight | 112.202 |
| Flash Point | 25.0±0.0 °C |
| Exact Mass | 112.115913 |
| LogP | 3.14 |
| Vapour Pressure | 7.6±0.1 mmHg at 25°C |
| Index of Refraction | 1.500 |
| InChIKey | IVSZLXZYQVIEFR-WFGJKAKNSA-N |
| SMILES | [2H]C([2H])([2H])C1=CC(=CC=C1)C([2H])([2H])[2H] |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Symbol |
GHS02, GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H226-H312-H315-H332 |
| Precautionary Statements | P280 |
| RIDADR | UN1307 - class 3 - PG 3 - Xylenes |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
1,3-Bis[(2H3)me... CAS#:29636-65-5 |
| Literature: Renaud; Leitch Canadian Journal of Chemistry, 1956 , vol. 34, p. 98,101 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 1 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1,3-Bis-trideuteriomethyl-benzol |
| 1,3-Dimethyl-d6-benzene |
| 1,3-Bis[(H)methyl]benzene |
| 1,3-bis-trideuteriomethyl-benzene |
| m-xylene-d6 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What are the upstream materials of 1,3-bis(trideuteriomethyl)benzene? |
| A: Related upstream materials(CAS) of 1,3-bis(trideuteriomethyl)benzene: 881-99-2. |
| Q: What is the LogP of 1,3-bis(trideuteriomethyl)benzene? |
| A: LogP of 1,3-bis(trideuteriomethyl)benzene is 3.14. |
| Q: What is the molecular weight of 1,3-bis(trideuteriomethyl)benzene? |
| A: Molecular weight of 1,3-bis(trideuteriomethyl)benzene is 112.202. |
| Q: What is the SMILES notation of 1,3-bis(trideuteriomethyl)benzene? |
| A: SMILES notation of 1,3-bis(trideuteriomethyl)benzene is [2H]C([2H])([2H])C1=CC(=CC=C1)C([2H])([2H])[2H]. |
| Q: What is the InChIKey of 1,3-bis(trideuteriomethyl)benzene? |
| A: InChIKey of 1,3-bis(trideuteriomethyl)benzene is IVSZLXZYQVIEFR-WFGJKAKNSA-N. |
| Q: What is the CAS number of 1,3-bis(trideuteriomethyl)benzene? |
| A: CAS number of 1,3-bis(trideuteriomethyl)benzene is 29636-65-5. |
| Q: What is the boiling point of 1,3-bis(trideuteriomethyl)benzene? |
| A: Boiling point of 1,3-bis(trideuteriomethyl)benzene is 140.6±10.0 °C at 760 mmHg. |
| Q: What is the English name of 1,3-bis(trideuteriomethyl)benzene? |
| A: The English name of 1,3-bis(trideuteriomethyl)benzene is 1,3-bis(trideuteriomethyl)benzene. |
| Q: What English synonyms does 1,3-bis(trideuteriomethyl)benzene have? |
| A: English synonyms of 1,3-bis(trideuteriomethyl)benzene: 1,3-Bis-trideuteriomethyl-benzol, 1,3-Dimethyl-d6-benzene, 1,3-Bis[(H)methyl]benzene, 1,3-bis-trideuteriomethyl-benzene, m-xylene-d6. |
| Q: What is the molecular formula of 1,3-bis(trideuteriomethyl)benzene? |
| A: Molecular formula of 1,3-bis(trideuteriomethyl)benzene is C8H4D6. |