2,6-Dichloro-3-nitrotoluene structure
|
Common Name | 2,6-Dichloro-3-nitrotoluene | ||
|---|---|---|---|---|
| CAS Number | 29682-46-0 | Molecular Weight | 206.026 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 293.8±35.0 °C at 760 mmHg | |
| Molecular Formula | C7H5Cl2NO2 | Melting Point | 53-56 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 131.5±25.9 °C | |
| Name | 1,3-dichloro-2-methyl-4-nitrobenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 293.8±35.0 °C at 760 mmHg |
| Melting Point | 53-56 °C(lit.) |
| Molecular Formula | C7H5Cl2NO2 |
| Molecular Weight | 206.026 |
| Flash Point | 131.5±25.9 °C |
| Exact Mass | 204.969727 |
| PSA | 45.82000 |
| LogP | 3.46 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.585 |
| InChIKey | WBNZUUIFTPNYRN-UHFFFAOYSA-N |
| SMILES | Cc1c(Cl)ccc([N+](=O)[O-])c1Cl |
| Water Solubility | Practically insoluble (0.043 g/L) (25 ºC) |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Hazard Codes | Xn: Harmful; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S37/39-S26 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2904909090 |
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
|
Highly selective hydrogenation of aromatic chloronitro compounds to aromatic chloroamines with ionic-liquid-like copolymer stabilized platinum nanocatalysts in ionic liquids. Yuan X, et al.
Green Chem. 12(2) , 228-233, (2010)
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
| 2,6-Dichlor-3-nitro-toluol |
| 2,5-DIAZASPIRO[3.5]NONANE-5-CARBOXYLIC ACID TERT-BUTYL ESTER |
| 2,6-Dichloro-3-nitrotoluene |
| EINECS 249-776-4 |
| Benzene,1,3-dichloro-2-methyl-4-nitro |
| MFCD00024185 |
| 1,3-Dichloro-2-methyl-4-nitrobenzene |
| 2,4-dichloro-3-methylnitrobenzene |
| 1,3-dichloro-2-methyl-4-nitro-benzene |