methyl 2-isopentyl-3-oxocyclopentaneacetate
Modify Date: 2025-09-12 20:01:35
methyl 2-isopentyl-3-oxocyclopentaneacetate structure
|
Common Name | methyl 2-isopentyl-3-oxocyclopentaneacetate | ||
|---|---|---|---|---|
| CAS Number | 29711-19-1 | Molecular Weight | 226.31200 | |
| Density | 0.982g/cm3 | Boiling Point | 302.3ºC at 760 mmHg | |
| Molecular Formula | C13H22O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 127.9ºC | |
| Name | methyl 2-[2-(3-methylbutyl)-3-oxocyclopentyl]acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 0.982g/cm3 |
|---|---|
| Boiling Point | 302.3ºC at 760 mmHg |
| Molecular Formula | C13H22O3 |
| Molecular Weight | 226.31200 |
| Flash Point | 127.9ºC |
| Exact Mass | 226.15700 |
| PSA | 43.37000 |
| LogP | 2.58100 |
| Vapour Pressure | 0.000996mmHg at 25°C |
| Index of Refraction | 1.451 |
| InChIKey | DGSQNDBKBFKKOZ-UHFFFAOYSA-N |
| SMILES | COC(=O)CC1CCC(=O)C1CCC(C)C |
| HS Code | 2918300090 |
|---|
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| Methyl 2-isopentyl-3-oxocyclopentaneacetate |