methyl 2,3-dibromo-3-(3,4-dimethoxyphenyl)propanoate structure
|
Common Name | methyl 2,3-dibromo-3-(3,4-dimethoxyphenyl)propanoate | ||
|---|---|---|---|---|
| CAS Number | 5401-66-1 | Molecular Weight | 382.04500 | |
| Density | 1.631g/cm3 | Boiling Point | 373.3ºC at 760 mmHg | |
| Molecular Formula | C12H14Br2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 179.6ºC | |
| Name | methyl 2,3-dibromo-3-(3,4-dimethoxyphenyl)propanoate |
|---|
| Density | 1.631g/cm3 |
|---|---|
| Boiling Point | 373.3ºC at 760 mmHg |
| Molecular Formula | C12H14Br2O4 |
| Molecular Weight | 382.04500 |
| Flash Point | 179.6ºC |
| Exact Mass | 379.92600 |
| PSA | 44.76000 |
| LogP | 3.07630 |
| Index of Refraction | 1.558 |
| InChIKey | VUQXQDMEVQHEDS-UHFFFAOYSA-N |
| SMILES | COC(=O)C(Br)C(Br)c1ccc(OC)c(OC)c1 |
| HS Code | 2918990090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 3 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |