Benzenamine,4,4'-dithiobis[2-methoxy- (9CI) structure
|
Common Name | Benzenamine,4,4'-dithiobis[2-methoxy- (9CI) | ||
|---|---|---|---|---|
| CAS Number | 29811-61-8 | Molecular Weight | 308.41900 | |
| Density | 1.34g/cm3 | Boiling Point | 492.5ºC at 760 mmHg | |
| Molecular Formula | C14H16N2O2S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 251.6ºC | |
| Name | 4-[(4-amino-3-methoxyphenyl)disulfanyl]-2-methoxyaniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.34g/cm3 |
|---|---|
| Boiling Point | 492.5ºC at 760 mmHg |
| Molecular Formula | C14H16N2O2S2 |
| Molecular Weight | 308.41900 |
| Flash Point | 251.6ºC |
| Exact Mass | 308.06500 |
| PSA | 121.10000 |
| LogP | 4.83000 |
| Vapour Pressure | 7.65E-10mmHg at 25°C |
| Index of Refraction | 1.688 |
| InChIKey | FZOHAJVWFPMQRW-UHFFFAOYSA-N |
| SMILES | COc1cc(SSc2ccc(N)c(OC)c2)ccc1N |
|
~%
Benzenamine,4,4... CAS#:29811-61-8 |
| Literature: Wojahn; Lerch Arzneimittel Forschung, 1952 , vol. 2, p. 455,460 |
|
~%
Benzenamine,4,4... CAS#:29811-61-8 |
| Literature: Hodgson; Handley Journal of the Chemical Society, 1928 , p. 626 |
|
~%
Benzenamine,4,4... CAS#:29811-61-8 |
| Literature: Hodgson; Handley Journal of the Chemical Society, 1928 , p. 626 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2,2'-Dimethoxy-4,4'-disulfandiyl-di-anilin |
| 4.4'-Diamino-3.3'-dimethoxy-diphenyldisulfid |