Benzyl 4-hydroxy-5,6,7-trimethoxy-2-naphthoate structure
|
Common Name | Benzyl 4-hydroxy-5,6,7-trimethoxy-2-naphthoate | ||
|---|---|---|---|---|
| CAS Number | 2982-18-5 | Molecular Weight | 368.38000 | |
| Density | 1.259g/cm3 | Boiling Point | 559.8ºC at 760 mmHg | |
| Molecular Formula | C21H20O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 197.8ºC | |
| Name | Benzyl 4-hydroxy-5,6,7-trimethoxy-2-naphthoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.259g/cm3 |
|---|---|
| Boiling Point | 559.8ºC at 760 mmHg |
| Molecular Formula | C21H20O6 |
| Molecular Weight | 368.38000 |
| Flash Point | 197.8ºC |
| Exact Mass | 368.12600 |
| PSA | 74.22000 |
| LogP | 3.92820 |
| Vapour Pressure | 3.9E-13mmHg at 25°C |
| Index of Refraction | 1.616 |
| InChIKey | WBCBANJXLILVPU-UHFFFAOYSA-N |
| SMILES | COc1cc2cc(C(=O)OCc3ccccc3)cc(O)c2c(OC)c1OC |
|
~%
Benzyl 4-hydrox... CAS#:2982-18-5 |
| Literature: Bell,K.H.; Weiss,U. Australian Journal of Chemistry, 1965 , vol. 18, p. 1273 - 1277 |
|
~%
Benzyl 4-hydrox... CAS#:2982-18-5 |
| Literature: Bell,K.H.; Weiss,U. Australian Journal of Chemistry, 1965 , vol. 18, p. 1273 - 1277 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 4-Hydroxy-5,6,7-trimethoxy-<2>naphthoesaeure |
| 2-Naphthalenecarboxylic acid,4-hydroxy-5,6,7-trimethoxy |
| 6,7,8-Trimethoxy-1-hydroxy-3-naphthoic acid |
| 4-Hydroxy-5,6,7-trimethoxy-<2>naphthoesaeure-benzylester |
| 4-Hydroxy-5,6,7-trimethoxy-2-naphthalenecarboxylic acid |