2-Thiophenemethanol,tetrahydro-a-phenyl-, 1,1-dioxide structure
|
Common Name | 2-Thiophenemethanol,tetrahydro-a-phenyl-, 1,1-dioxide | ||
|---|---|---|---|---|
| CAS Number | 29866-60-2 | Molecular Weight | 226.29200 | |
| Density | 1.316g/cm3 | Boiling Point | 452.5ºC at 760mmHg | |
| Molecular Formula | C11H14O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 227.4ºC | |
| Name | threo-Phenyl-(1,1-dioxy-2-thiolanyl)-carbinol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.316g/cm3 |
|---|---|
| Boiling Point | 452.5ºC at 760mmHg |
| Molecular Formula | C11H14O3S |
| Molecular Weight | 226.29200 |
| Flash Point | 227.4ºC |
| Exact Mass | 226.06600 |
| PSA | 62.75000 |
| LogP | 2.37800 |
| InChIKey | MQYLMSZREIAQMO-UHFFFAOYSA-N |
| SMILES | O=S1(=O)CCCC1C(O)c1ccccc1 |
|
~%
2-Thiophenemeth... CAS#:29866-60-2 |
| Literature: Truce; Buser Journal of the American Chemical Society, 1954 , vol. 76, p. 3577 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 3-diethylamino-2,3-dihydrothiophene-1,1-dioxide |
| erythro-Phenyl-(1,1-dioxy-2-thiolanyl)-carbinol |