(1R,4R)-4-((Tert-butoxycarbonyl)amino)cyclopent-2-enecarboxylic acid structure
|
Common Name | (1R,4R)-4-((Tert-butoxycarbonyl)amino)cyclopent-2-enecarboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 298716-03-7 | Molecular Weight | 227.257 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 382.3±42.0 °C at 760 mmHg | |
| Molecular Formula | C11H17NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 185.0±27.9 °C | |
| Name | (1R,4R)-4-(Boc-aMino)cyclopent-2-enecarboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 382.3±42.0 °C at 760 mmHg |
| Molecular Formula | C11H17NO4 |
| Molecular Weight | 227.257 |
| Flash Point | 185.0±27.9 °C |
| Exact Mass | 227.115753 |
| PSA | 75.63000 |
| LogP | 1.12 |
| Vapour Pressure | 0.0±1.9 mmHg at 25°C |
| Index of Refraction | 1.515 |
| InChIKey | WOUNTSATDZJBLP-YUMQZZPRSA-N |
| SMILES | CC(C)(C)OC(=O)NC1C=CC(C(=O)O)C1 |
| Hazard Codes | Xn |
|---|---|
| HS Code | 2924299090 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-Cyclopentene-1-carboxylic acid, 4-[[(1,1-dimethylethoxy)carbonyl]amino]-, (1R,4R)- |
| (1R,4R)-4-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)-2-cyclopentene-1-carboxylic acid |
| D-CAMPHOR OXIME |
| (1R,4R)-4-(Boc-amino)cyclopent-2-enecarboxylic acid |
| (1R,4R)-4-((tert-Butoxycarbonyl)amino)cyclopent-2-enecarboxylic acid |
| 2-Norbornyl oxime |