Neoamygdalin structure
|
Common Name | Neoamygdalin | ||
|---|---|---|---|---|
| CAS Number | 29883-16-7 | Molecular Weight | 457.43 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H27NO11 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of NeoamygdalinNeoamygdalin is a compound identified in the different processed bitter almonds. Neoamygdalin has the potential for the research of cough and asthma[1]. |
| Name | [O-β-D-glucopyranosyl-(1-6)-β-D-glucopyranosyloxy]benzeneacetonitrile |
|---|---|
| Synonym | More Synonyms |
| Description | Neoamygdalin is a compound identified in the different processed bitter almonds. Neoamygdalin has the potential for the research of cough and asthma[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C20H27NO11 |
|---|---|
| Molecular Weight | 457.43 |
| Exact Mass | 457.15800 |
| PSA | 202.32000 |
| InChIKey | XUCIJNAGGSZNQT-UUGBRMIUSA-N |
| SMILES | N#CC(OC1OC(COC2OC(CO)C(O)C(O)C2O)C(O)C(O)C1O)c1ccccc1 |
| (S)-neoamygdalin |
| (S)-mandelonitrile β-gentiobioside |
| Neoamygdalin |
| amygdalin |
| (S)-Phenyl-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-((2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-hydroxymethyl-tetrahydro-pyran-2-yloxymethyl)-tetrahydro-pyran-2-yloxy]-acetonitrile |
| (S)-(6-O-β-D-glucopyranosyl-β-D-glucopyranosyloxy)(phenyl)acetonitrile |