Urea,N,N-dimethyl-N',N'-diphenyl structure
|
Common Name | Urea,N,N-dimethyl-N',N'-diphenyl | ||
|---|---|---|---|---|
| CAS Number | 2990-01-4 | Molecular Weight | 240.30000 | |
| Density | 1.136g/cm3 | Boiling Point | 346.2ºC at 760mmHg | |
| Molecular Formula | C15H16N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 140ºC | |
| Name | 1,1-dimethyl-3,3-diphenylurea |
|---|---|
| Synonym | More Synonyms |
| Density | 1.136g/cm3 |
|---|---|
| Boiling Point | 346.2ºC at 760mmHg |
| Molecular Formula | C15H16N2O |
| Molecular Weight | 240.30000 |
| Flash Point | 140ºC |
| Exact Mass | 240.12600 |
| PSA | 23.55000 |
| LogP | 3.50630 |
| Vapour Pressure | 5.86E-05mmHg at 25°C |
| Index of Refraction | 1.61 |
| InChIKey | JPMQWSJHCDLANT-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)N(c1ccccc1)c1ccccc1 |
|
~75%
Urea,N,N-dimeth... CAS#:2990-01-4 |
| Literature: Chan, Dominic M. T. Tetrahedron Letters, 1996 , vol. 37, # 50 p. 9013 - 9016 |
|
~%
Urea,N,N-dimeth... CAS#:2990-01-4 |
| Literature: Hanson,P.; Williams,D.A.R. Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), 1973 , p. 2162 - 2165 |
|
~%
Urea,N,N-dimeth... CAS#:2990-01-4 |
| Literature: Goodrich Co. Patent: US2722550 , 1951 ; |
| Dimethyl-diphenyl-harnstoff |
| non-symmetric diphenyldimethylurea |
| N,N-Dimethyl-N',N'-diphenyl-harnstoff |
| N,N-Dimethyl-diphenyl-harnstoff |
| N,N'-dimethyl-N,N'-diphenylethylenediamine |
| N,N-dimethyl-N',N'-diphenyl-urea |
| Ethylenediamine,N,N'-dimethyl-N,N'-diphenyl |
| 1,2-Ethanediamine,N,N'-dimethyl-N,N'-diphenyl |
| N.N-Diphenyl-N.N-dimethylharnstoff |
| N,N'-Dimethyl-N,N'-diphenyl-aethylendiamin |