Diphenylcarbamic chloride structure
|
Common Name | Diphenylcarbamic chloride | ||
|---|---|---|---|---|
| CAS Number | 83-01-2 | Molecular Weight | 231.678 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 361.8±15.0 °C at 760 mmHg | |
| Molecular Formula | C13H10ClNO | Melting Point | 83-85 °C | |
| MSDS | Chinese USA | Flash Point | 172.6±20.4 °C | |
| Symbol |
GHS05, GHS07 |
Signal Word | Danger | |
| Name | Diphenylcarbamyl chloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 361.8±15.0 °C at 760 mmHg |
| Melting Point | 83-85 °C |
| Molecular Formula | C13H10ClNO |
| Molecular Weight | 231.678 |
| Flash Point | 172.6±20.4 °C |
| Exact Mass | 231.045090 |
| PSA | 20.31000 |
| LogP | 3.75 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.633 |
| InChIKey | XNBKKRFABABBPM-UHFFFAOYSA-N |
| SMILES | O=C(Cl)N(c1ccccc1)c1ccccc1 |
| Storage condition | Refrigerator |
| Water Solubility | reacts |
| Symbol |
GHS05, GHS07 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H314-H317 |
| Precautionary Statements | P280-P305 + P351 + P338-P310 |
| Personal Protective Equipment | Eyeshields;Faceshields;full-face particle respirator type N100 (US);Gloves;respirator cartridge type N100 (US);type P1 (EN143) respirator filter;type P3 (EN 143) respirator cartridges |
| Hazard Codes | C:Corrosive; |
| Risk Phrases | R29;R34 |
| Safety Phrases | S26-S36/37/39-S45-S28A |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| RTECS | EY5065000 |
| Packaging Group | II |
| Hazard Class | 8 |
| HS Code | 29242995 |
| Precursor 9 | |
|---|---|
| DownStream 9 | |
| HS Code | 2903999090 |
|---|---|
| Summary | 2903999090 halogenated derivatives of aromatic hydrocarbons VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
|
Skeletal keratan sulphate chains isolated from bovine intervertebral disc may terminate in alpha(2----6)-linked N-acetylneuraminic acid.
Biochem. J. 282 ( Pt 1) , 267-71, (1992) Peptido-keratan sulphate fragments were isolated from the nucleus pulposus of bovine intervertebral discs (2-year-old animals) after digestion with chondroitin ABC lyase followed by digestion with dip... |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
| diphenyl-carbamoyl chloride |
| MFCD00000633 |
| diphenyl-carbamoylchlorid |
| DIPHENYLUREA CHLORIDE |
| Diphenylcarbamylchloride |
| diphenylcarbamyl chloride |
| N,N-diphenyl-carbamoylchloride |
| diphenyl-carabamicchlorid |
| Diphenylcarbamyl chl |
| EINECS 201-450-2 |
| diphenylchloroformamide |
| N,N-diphenylcarbamyl chloride |
| diphenyl-carbamicchlorid |
| Diphenylcarbamic chloride |