1,7-Phenanthroline-8-carbonitrile,7-benzoyl-7,8-dihydro- structure
|
Common Name | 1,7-Phenanthroline-8-carbonitrile,7-benzoyl-7,8-dihydro- | ||
|---|---|---|---|---|
| CAS Number | 29924-57-0 | Molecular Weight | 311.33700 | |
| Density | 1.35g/cm3 | Boiling Point | 575.6ºC at 760 mmHg | |
| Molecular Formula | C20H13N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 301.9ºC | |
| Name | 7-benzoyl-8H-1,7-phenanthroline-8-carbonitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.35g/cm3 |
|---|---|
| Boiling Point | 575.6ºC at 760 mmHg |
| Molecular Formula | C20H13N3O |
| Molecular Weight | 311.33700 |
| Flash Point | 301.9ºC |
| Exact Mass | 311.10600 |
| PSA | 56.99000 |
| LogP | 3.86558 |
| Vapour Pressure | 2.98E-13mmHg at 25°C |
| Index of Refraction | 1.728 |
| InChIKey | SUSVEGRGOYEOMQ-UHFFFAOYSA-N |
| SMILES | N#CC1C=Cc2c(ccc3cccnc23)N1C(=O)c1ccccc1 |
|
~%
1,7-Phenanthrol... CAS#:29924-57-0 |
| Literature: Bhattacharjee, D.; Popp, F. D. Journal of Heterocyclic Chemistry, 1980 , vol. 17, p. 1207 - 1210 |
| 1,7-benzoyl-7,8-dihydro |
| 7-Benzoyl-8-cyan-7,8-dihydro-1,7-phenanthrolin |
| 7-benzoyl-8-cyano-7,8-dihydro-1,7-phenanthroline |
| 7-Benzoyl-7,8-dihydro[1,7]phenanthroline-8-carbonitrile |