Benzaldehyde,2-(2,4-dinitrophenyl)hydrazone structure
|
Common Name | Benzaldehyde,2-(2,4-dinitrophenyl)hydrazone | ||
|---|---|---|---|---|
| CAS Number | 1157-84-2 | Molecular Weight | 286.24300 | |
| Density | 1.39 g/cm3 | Boiling Point | 458.5ºC at 760 mmHg | |
| Molecular Formula | C13H10N4O4 | Melting Point | 239-241 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 231.1ºC | |
| Symbol |
GHS02, GHS07 |
Signal Word | Danger | |
| Name | benzaldehyde 2,4-dinitrophenylhydrazone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.39 g/cm3 |
|---|---|
| Boiling Point | 458.5ºC at 760 mmHg |
| Melting Point | 239-241 °C(lit.) |
| Molecular Formula | C13H10N4O4 |
| Molecular Weight | 286.24300 |
| Flash Point | 231.1ºC |
| Exact Mass | 286.07000 |
| PSA | 116.03000 |
| LogP | 4.06840 |
| Vapour Pressure | 1.36E-08mmHg at 25°C |
| Index of Refraction | 1.649 |
| InChIKey | DZPRPFUXOZTWAJ-NTEUORMPSA-N |
| SMILES | O=[N+]([O-])c1ccc(NN=Cc2ccccc2)c([N+](=O)[O-])c1 |
| Storage condition | 2-8°C |
| Stability | Stable. Incompatible with strong oxidizing agents. |
| Symbol |
GHS02, GHS07 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H225-H302 + H312 + H332-H319 |
| Precautionary Statements | P210-P280-P305 + P351 + P338 |
| Hazard Codes | T: Toxic;Xi: Irritant;F: Flammable;Xn: Harmful; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36-S45-S27-S16-S39 |
| RIDADR | UN 1648 3/PG 2 |
| WGK Germany | 3 |
| Hazard Class | 1.0 |
| HS Code | 2928000090 |
| Precursor 10 | |
|---|---|
| DownStream 7 | |
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
|
Name: Inhibitors of CDC25B-CDK2/CyclinA interaction
Source: Center for Chemical Genomics, University of Michigan
External Id: MScreen:TargetID_600
|
| BENZALDEHYDE 2,4-DINTROPHENYLHYDRAZONE |
| benzaldehyde 2,4-dinitrohydrazone |
| BENZALDEHYDE (2,4-DINITROPHENYL)HYDRAZONE |
| Benzaldehyde-2,4-dinitrophenylhydrazone |
| BENZALDEHYDE-DNPH |
| Benzaldehyde-2,4-DNPH |
| BENZALDEHYDE-2,4-DNPH,100MG,NEAT |
| benzaldehyde-2,4-dnph solution |
| Benzaldehyde 2,4-Dinitrophenylhydrazone |
| DNP of benzaldehyde |
| MFCD00156353 |
| EINECS 200-835-2 |