Perfluorodimethylcyclobutane structure
|
Common Name | Perfluorodimethylcyclobutane | ||
|---|---|---|---|---|
| CAS Number | 2994-71-0 | Molecular Weight | 192.102 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 55.9±35.0 °C at 760 mmHg | |
| Molecular Formula | C6H6F6 | Melting Point | -32ºC(lit.) | |
| MSDS | N/A | Flash Point | -1.0±17.9 °C | |
| Name | perfluorodimethylcyclobutane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 55.9±35.0 °C at 760 mmHg |
| Melting Point | -32ºC(lit.) |
| Molecular Formula | C6H6F6 |
| Molecular Weight | 192.102 |
| Flash Point | -1.0±17.9 °C |
| Exact Mass | 192.037369 |
| LogP | 1.77 |
| Vapour Pressure | 244.4±0.1 mmHg at 25°C |
| Index of Refraction | 1.334 |
| InChIKey | RBTROQHBNLSUTL-UHFFFAOYSA-N |
| SMILES | FC(F)(F)C1(F)C(F)(F)C(F)(F)C1(F)C(F)(F)F |
| Water Solubility | Immiscible with water. |
| Hazard Codes | F,Xi |
|---|---|
| Risk Phrases | 11-36/37/38 |
| Safety Phrases | S16-S26-S36 |
| WGK Germany | 3 |
| HS Code | 2903890090 |
| HS Code | 2903890090 |
|---|---|
| Summary | 2903890090. halogenated derivatives of cyclanic, cyclenic or cyclotherpenic hydrocarbons. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:5.5%. General tariff:30.0% |
| Perfluor-1,2-dimethyl-cyclobutan |
| DODECAFLUORODIMETHYLCYCLOBUTANE |
| Cyclobutane, 1,1-bis(trifluoromethyl)- |
| Perfluoro-dimethyl-cyclobutan |
| MFCD00013737 |
| 1,1-Bis(trifluoromethyl)cyclobutane |
| Perfluor-dimethylcyclobutan |
| EINECS 221-065-3 |
| Perfluoro-1,2-dimethylcyclobutane |