3-Benzoyl-2-thiophenecarboxylic acid structure
|
Common Name | 3-Benzoyl-2-thiophenecarboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 30006-03-2 | Molecular Weight | 232.25500 | |
| Density | 1.369 g/cm3 | Boiling Point | 206-210 °C(lit.) | |
| Molecular Formula | C12H8O3S | Melting Point | 86-89 °C(lit.) | |
| MSDS | N/A | Flash Point | 90 °C | |
| Name | 3-benzoylthiophene-2-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.369 g/cm3 |
|---|---|
| Boiling Point | 206-210 °C(lit.) |
| Melting Point | 86-89 °C(lit.) |
| Molecular Formula | C12H8O3S |
| Molecular Weight | 232.25500 |
| Flash Point | 90 °C |
| Exact Mass | 232.01900 |
| PSA | 82.61000 |
| LogP | 2.67730 |
| Index of Refraction | 1.643 |
| InChIKey | ZKHLBCVFVQJMBT-UHFFFAOYSA-N |
| SMILES | O=C(c1ccccc1)c1ccsc1C(=O)O |
| Hazard Codes | Xn |
|---|---|
| Risk Phrases | R22:Harmful if swallowed. |
| Safety Phrases | S36/37/39 |
| WGK Germany | 1 |
| RTECS | GW1925000 |
| HS Code | 29280090 |
|
~%
3-Benzoyl-2-thi... CAS#:30006-03-2 |
| Literature: US5585385 A1, ; |
|
~%
3-Benzoyl-2-thi... CAS#:30006-03-2 |
| Literature: Journal of Organic Chemistry, , vol. 18, p. 133,136 |
|
~%
3-Benzoyl-2-thi... CAS#:30006-03-2 |
| Literature: Journal of Organic Chemistry, , vol. 18, p. 133,136 |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-Benzoylthiophen-2-carbonsaeure |
| 3-benzoyl-thiophene-2-carboxylic acid |
| 3-benzoyl-2-thiophenecarboxylic acid |
| MFCD00159542 |
| 3-Benzoylthiophene-2-carboxylic acid |