WAY-322475 structure
|
Common Name | WAY-322475 | ||
|---|---|---|---|---|
| CAS Number | 300731-73-1 | Molecular Weight | 265.3131 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 537.8±50.0 °C at 760 mmHg | |
| Molecular Formula | C15H15N5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 279.0±30.1 °C | |
Use of WAY-322475GRK6 inhibitor; SUMOylation inhibitor; |
| Name | WAY-322475 |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 537.8±50.0 °C at 760 mmHg |
| Molecular Formula | C15H15N5 |
| Molecular Weight | 265.3131 |
| Flash Point | 279.0±30.1 °C |
| Exact Mass | 265.132751 |
| LogP | 4.36 |
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |
| Index of Refraction | 1.698 |
| InChIKey | OLICCRYPRZAUNK-UHFFFAOYSA-N |
| SMILES | CCCCn1c(N)c(C#N)c2nc3ccccc3nc21 |
| 1H-Pyrrolo[2,3-b]quinoxaline-3-carbonitrile, 2-amino-1-butyl- |
| 2-Amino-1-butyl-1H-pyrrolo[2,3-b]quinoxaline-3-carbonitrile |