|cis|-4,7,10,13,16,19-Docosahexaenoic acid methyl ester
|cis|-4,7,10,13,16,19-Docosahexaenoic acid methyl ester structure
|
Common Name | |cis|-4,7,10,13,16,19-Docosahexaenoic acid methyl ester | ||
|---|---|---|---|---|
| CAS Number | 301-01-9 | Molecular Weight | 342.515 | |
| Density | 0.9±0.1 g/cm3 | Boiling Point | 429.9±24.0 °C at 760 mmHg | |
| Molecular Formula | C23H34O2 | Melting Point | N/A | |
| MSDS | Chinese | Flash Point | 103.9±21.2 °C | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | cis-4,7,10,13,16,19-docosahexaenoic acid methyl ester |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 0.9±0.1 g/cm3 |
|---|---|
| Boiling Point | 429.9±24.0 °C at 760 mmHg |
| Molecular Formula | C23H34O2 |
| Molecular Weight | 342.515 |
| Flash Point | 103.9±21.2 °C |
| Exact Mass | 342.255890 |
| PSA | 26.30000 |
| LogP | 7.24 |
| Appearance of Characters | Liquid |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.505 |
| InChIKey | VCDLWFYODNTQOT-DMGWNJAXSA-N |
| SMILES | CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OC |
| Storage condition | −20°C |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Hazard Codes | F,Xn,N |
|---|---|
| Risk Phrases | 11-38-50/53-65-67 |
| Safety Phrases | S23 |
| RIDADR | UN 1206 3/PG 2 |
| WGK Germany | 3 |
| Hazard Class | 3.0 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| CIS-4,7,10,13,16,19-DOCOSAHEXAENOIC*ACID METHYL EST |
| CIS-4,7,10,13,16,19-DOCOSHEXAENOIC ACID METHYL ESTER |
| MethylDocosahexaenoate(4c,7c,10c,13c,16c,19c) |
| cis-4,7,10,13,16,19-docosahexaenoic*acid methyl E |
| cis-4,7,10,13,16,19-Docosahexaenoic acid methyl ester |
| Methyl (4E,7E,10E,13E,16E,19E)-4,7,10,13,16,19-docosahexaenoate |
| Methyldocosahexaenoat |
| cis-4,7,10,13,16,19-Docosahexaenoic acid methyl ester,Methyl 4,7,10,13,16,19-docosahexaenoate |
| cis-4,7,10,13,16,19-docosahexaenoic methyl ester |
| METHYL 4,7,10,13,16,19-DOCOSAHEXAENOATE |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of cis-4,7,10,13,16,19-docosahexaenoic acid methyl ester? |
| A: Molecular formula of cis-4,7,10,13,16,19-docosahexaenoic acid methyl ester is C23H34O2. |
| Q: What is the SMILES notation of cis-4,7,10,13,16,19-docosahexaenoic acid methyl ester? |
| A: SMILES notation of cis-4,7,10,13,16,19-docosahexaenoic acid methyl ester is CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OC. |
| Q: What is the physical appearance of cis-4,7,10,13,16,19-docosahexaenoic acid methyl ester? |
| A: cis-4,7,10,13,16,19-docosahexaenoic acid methyl ester appears as Liquid. |
| Q: What is the molecular weight of cis-4,7,10,13,16,19-docosahexaenoic acid methyl ester? |
| A: Molecular weight of cis-4,7,10,13,16,19-docosahexaenoic acid methyl ester is 342.515. |
| Q: What is the English name of cis-4,7,10,13,16,19-docosahexaenoic acid methyl ester? |
| A: The English name of cis-4,7,10,13,16,19-docosahexaenoic acid methyl ester is cis-4,7,10,13,16,19-docosahexaenoic acid methyl ester. |
| Q: What is the safety information for cis-4,7,10,13,16,19-docosahexaenoic acid methyl ester? |
| A: Safety information for cis-4,7,10,13,16,19-docosahexaenoic acid methyl ester: S23. |
| Q: What is the polar surface area (PSA) of cis-4,7,10,13,16,19-docosahexaenoic acid methyl ester? |
| A: Polar surface area (PSA) of cis-4,7,10,13,16,19-docosahexaenoic acid methyl ester is 26.30000. |
| Q: What is the InChIKey of cis-4,7,10,13,16,19-docosahexaenoic acid methyl ester? |
| A: InChIKey of cis-4,7,10,13,16,19-docosahexaenoic acid methyl ester is VCDLWFYODNTQOT-DMGWNJAXSA-N. |
| Q: What is the boiling point of cis-4,7,10,13,16,19-docosahexaenoic acid methyl ester? |
| A: Boiling point of cis-4,7,10,13,16,19-docosahexaenoic acid methyl ester is 429.9±24.0 °C at 760 mmHg. |
| Q: What are the storage conditions for cis-4,7,10,13,16,19-docosahexaenoic acid methyl ester? |
| A: Storage conditions for cis-4,7,10,13,16,19-docosahexaenoic acid methyl ester: −20°C. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |