GI-570310 structure
|
Common Name | GI-570310 | ||
|---|---|---|---|---|
| CAS Number | 301210-82-2 | Molecular Weight | 291.26 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 461.6±40.0 °C at 760 mmHg | |
| Molecular Formula | C13H13N3O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 232.9±27.3 °C | |
Use of GI-570310a-glucosidase inhibitors a-glucosidase inhibitors |
| Name | GI-570310 |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 461.6±40.0 °C at 760 mmHg |
| Molecular Formula | C13H13N3O5 |
| Molecular Weight | 291.26 |
| Flash Point | 232.9±27.3 °C |
| Exact Mass | 291.085510 |
| LogP | 1.22 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.636 |
| InChIKey | CWKLCBJZEKEMMS-UHFFFAOYSA-N |
| SMILES | O=C1c2ccc([N+](=O)[O-])cc2C(=O)N1CN1CCOCC1 |
| 2-Morpholin-4-ylmethyl-5-nitro-isoindole-1,3-dione |
| 1H-Isoindole-1,3(2H)-dione, 2-(4-morpholinylmethyl)-5-nitro- |
| 2-(4-Morpholinylmethyl)-5-nitro-1H-isoindole-1,3(2H)-dione |