GI-568125
Modify Date: 2025-09-02 23:07:44
GI-568125 structure
|
Common Name | GI-568125 | ||
|---|---|---|---|---|
| CAS Number | 913488-18-3 | Molecular Weight | 161.2 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H11N3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of GI-568125analgesic activity/moderate affinity (on the micromolar level) toward opioid (μ) and serotonin (5HT2) receptors analgesic activity/moderate affinity (on the micromolar level) toward opioid (μ) and serotonin (5HT2) receptors |
| Name | GI-568125 |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C9H11N3 |
|---|---|
| Molecular Weight | 161.2 |
| InChIKey | YCNQROPWUVWWKB-UHFFFAOYSA-N |
| SMILES | CCN(Cc1ccccc1)C(=O)C1(S(=O)(=O)c2ccc(C)cc2)CC1 |
| Cyclopropanecarboxamide, N-ethyl-1-[(4-methylphenyl)sulfonyl]-N-(phenylmethyl)- |