2,6-Dichloro-N-(4-Methoxyphenyl) Benzenamine structure
|
Common Name | 2,6-Dichloro-N-(4-Methoxyphenyl) Benzenamine | ||
|---|---|---|---|---|
| CAS Number | 30124-19-7 | Molecular Weight | 268.13900 | |
| Density | 1.318 g/cm3 | Boiling Point | 346.4ºC at 760 mmHg | |
| Molecular Formula | C13H11Cl2NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 163.3ºC | |
| Name | 2,6-dichloro-N-(4-methoxyphenyl)aniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.318 g/cm3 |
|---|---|
| Boiling Point | 346.4ºC at 760 mmHg |
| Molecular Formula | C13H11Cl2NO |
| Molecular Weight | 268.13900 |
| Flash Point | 163.3ºC |
| Exact Mass | 267.02200 |
| PSA | 21.26000 |
| LogP | 4.81860 |
| Index of Refraction | 1.627 |
| InChIKey | BLFDNLHOYIEHMA-UHFFFAOYSA-N |
| SMILES | COc1ccc(Nc2c(Cl)cccc2Cl)cc1 |
| HS Code | 2922199090 |
|---|
| Precursor 6 | |
|---|---|
| DownStream 3 | |
| HS Code | 2922199090 |
|---|---|
| Summary | 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2,6-dichloro-4'-methoxydiphenylamine |
| BEN065 |