5-Hydroxydiclofenac structure
|
Common Name | 5-Hydroxydiclofenac | ||
|---|---|---|---|---|
| CAS Number | 69002-84-2 | Molecular Weight | 312.148 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 444.8±45.0 °C at 760 mmHg | |
| Molecular Formula | C14H11Cl2NO3 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 222.8±28.7 °C | |
| Symbol |
GHS07, GHS09 |
Signal Word | Warning | |
| Name | 5-hydroxydiclofenac |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 444.8±45.0 °C at 760 mmHg |
| Molecular Formula | C14H11Cl2NO3 |
| Molecular Weight | 312.148 |
| Flash Point | 222.8±28.7 °C |
| Exact Mass | 311.011597 |
| PSA | 69.56000 |
| LogP | 3.91 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.690 |
| InChIKey | VNQURRWYKFZKJZ-UHFFFAOYSA-N |
| SMILES | O=C(O)Cc1cc(O)ccc1Nc1c(Cl)cccc1Cl |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Symbol |
GHS07, GHS09 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H315-H319-H335-H410 |
| Precautionary Statements | P273-P280-P301 + P312 + P330-P337 + P313-P391-P501 |
| RIDADR | UN 3077 9 / PGIII |
| Precursor 9 | |
|---|---|
| DownStream 1 | |
|
Name: Glutathione reactivity of the compound assessed as GSH-adduct formation at 0.5 mg/ml ...
Source: ChEMBL
Target: N/A
External Id: CHEMBL5166495
|
|
Name: Displacement of [3H]NCS-382 from CaMK2alpha in rat brain cerebral cortex membrane hom...
Source: ChEMBL
Target: Calcium/calmodulin-dependent protein kinase type II subunit alpha
External Id: CHEMBL5166478
|
|
Name: Inhibition of COX (unknown origin)
Source: ChEMBL
Target: Prostaglandin G/H synthase 1
External Id: CHEMBL2432168
|
|
Name: Inhibition of inflammatory hind paw edema, induced by Mycobacterium butyricum in rats...
Source: ChEMBL
Target: Rattus norvegicus
External Id: CHEMBL797721
|
|
Name: In vitro inhibition of bovine prostaglandin G/H synthase, using bovine seminal vesicl...
Source: ChEMBL
Target: Prostaglandin G/H synthase 1
External Id: CHEMBL858257
|
|
Name: Displacement of [3H]NCS-382 from CaMK2alpha in rat brain cortical membrane homogenate...
Source: ChEMBL
Target: Calcium/calmodulin-dependent protein kinase type II subunit alpha
External Id: CHEMBL5099988
|
|
Name: Displacement of [3H]HOCPCA from native CaMK2alpha in rat brain cortical membrane homo...
Source: ChEMBL
Target: Calcium/calmodulin-dependent protein kinase type II subunit alpha
External Id: CHEMBL5099989
|
|
Name: Displacement of [3H]HOCPCA from recombinant rat CaMK2alpha expressed in HEK293T cells...
Source: ChEMBL
Target: Calcium/calmodulin-dependent protein kinase type II subunit alpha
External Id: CHEMBL5099990
|
| 5-Hydroxydiclofenac |
| 5-OH DCF |
| {2-[(2,6-Dichlorophenyl)amino]-5-hydroxyphenyl}acetic acid |
| 2-[2-(2,6-dichloroanilino)-5-hydroxyphenyl]acetic acid |
| 5-hydroxydiclophenac |