Ethanone,1-[2-(1-methylethenyl)-5-benzofuranyl]- structure
|
Common Name | Ethanone,1-[2-(1-methylethenyl)-5-benzofuranyl]- | ||
|---|---|---|---|---|
| CAS Number | 3015-20-1 | Molecular Weight | 200.23300 | |
| Density | 1.09g/cm3 | Boiling Point | 311.6ºC at 760mmHg | |
| Molecular Formula | C13H12O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 143.2ºC | |
| Name | 1-(2-prop-1-en-2-yl-1-benzofuran-5-yl)ethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.09g/cm3 |
|---|---|
| Boiling Point | 311.6ºC at 760mmHg |
| Molecular Formula | C13H12O2 |
| Molecular Weight | 200.23300 |
| Flash Point | 143.2ºC |
| Exact Mass | 200.08400 |
| PSA | 30.21000 |
| LogP | 3.66850 |
| Index of Refraction | 1.574 |
| InChIKey | DMYZBECNVZSNRN-UHFFFAOYSA-N |
| SMILES | C=C(C)c1cc2cc(C(C)=O)ccc2o1 |
| HS Code | 2932999099 |
|---|
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| dehydrotremetone |