seneganolide structure
|
Common Name | seneganolide | ||
|---|---|---|---|---|
| CAS Number | 301530-12-1 | Molecular Weight | 470.51 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 712.5±60.0 °C at 760 mmHg | |
| Molecular Formula | C26H30O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 384.7±32.9 °C | |
Use of seneganolideSeneganolide (compound 1) is isolated from the stem bark of Khaya senegalensis. Seneganolide can be used as insect antifeedant[1]. |
| Name | (1S,2R,6R,7R,10R,11S,16S,20R)-6-(3-Furyl)-20-hydroxy-7,17,17-trimethyl-5,13,21-trioxahexacyclo[17.2.1.01,10.02,7.011,16.011,20]docosane-4,14,18-trione |
|---|---|
| Synonym | More Synonyms |
| Description | Seneganolide (compound 1) is isolated from the stem bark of Khaya senegalensis. Seneganolide can be used as insect antifeedant[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 712.5±60.0 °C at 760 mmHg |
| Molecular Formula | C26H30O8 |
| Molecular Weight | 470.51 |
| Flash Point | 384.7±32.9 °C |
| Exact Mass | 470.194061 |
| PSA | 112.27000 |
| LogP | 1.10 |
| Vapour Pressure | 0.0±2.4 mmHg at 25°C |
| Index of Refraction | 1.621 |
| InChIKey | VIOKSDWKSSMHBF-MQELVVIJSA-N |
| SMILES | CC1(C)C(=O)C2CC34OC2(O)C2(COC(=O)CC12)C3CCC1(C)C(c2ccoc2)OC(=O)CC14 |
| Hazard Codes | Xi |
|---|
| (1R,2R,5R,6R,10S,11R,13R,14R,18S)-6-(3-Furyl)-13-hydroxy-5,17,17-trimethyl-7,12,22-trioxahexacyclo[11.9.0.0.0.0.0]docosane-8,16,21-trione |
| 5H,12H-4b,6,12a-(Epoxymetheno)-1H,3H-pyrano[3',4':3,4]cycloocta[1,2-f]-2-benzopyran-3,7,10(6H,8H)-trione, 1-(3-furanyl)octahydro-15-hydroxy-8,8,14a-trimethyl-, (1R,4aR,4bS,8aS,12aS,12bR,14aR,15R)- |
| (1S,2R,6R,7R,10R,11S,16S,20R)-6-(3-Furyl)-20-hydroxy-7,17,17-trimethyl-5,13,21-trioxahexacyclo[17.2.1.0.0.0.0]docosane-4,14,18-trione |
| 1H,3H-4b,5,12a-(Epoxymetheno)pyrano[2',3':3,4]cycloocta[1,2-f]-2-benzopyran-3,7,11-trione, 1-(3-furanyl)dodecahydro-15-hydroxy-8,8,14a-trimethyl-, (1R,4aS,4bR,5R,8aS,12aR,12bR,14aR,15R)- |