(2r,3r)-tartranilic acid structure
|
Common Name | (2r,3r)-tartranilic acid | ||
|---|---|---|---|---|
| CAS Number | 3019-58-7 | Molecular Weight | 225.19800 | |
| Density | 1.543g/cm3 | Boiling Point | 592ºC at 760 mmHg | |
| Molecular Formula | C10H11NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 311.8ºC | |
| Name | (2R,3R)-4-anilino-2,3-dihydroxy-4-oxobutanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.543g/cm3 |
|---|---|
| Boiling Point | 592ºC at 760 mmHg |
| Molecular Formula | C10H11NO5 |
| Molecular Weight | 225.19800 |
| Flash Point | 311.8ºC |
| Exact Mass | 225.06400 |
| PSA | 106.86000 |
| Index of Refraction | 116 ° (C=1, MeOH) |
| InChIKey | ZWXNRJCDXZFNLJ-HTQZYQBOSA-N |
| SMILES | O=C(O)C(O)C(O)C(=O)Nc1ccccc1 |
| Risk Phrases | 36/37/38 |
|---|---|
| Safety Phrases | 26-36/37/39 |
| HS Code | 2924299090 |
|
~99%
(2r,3r)-tartran... CAS#:3019-58-7 |
| Literature: Shin, Jai Moo; Kim, Yong Hae Tetrahedron Letters, 1986 , vol. 27, # 17 p. 1921 - 1924 |
|
~%
(2r,3r)-tartran... CAS#:3019-58-7 |
| Literature: Journal of the American Chemical Society, , vol. 31, p. 1239 |
|
~%
(2r,3r)-tartran... CAS#:3019-58-7 |
| Literature: Journal of the American Chemical Society, , vol. 70, p. 1354 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N-phenyl-Lg-tartramic acid |
| MFCD01321193 |
| (2R,3R)-2,3-Dihydroxy-3-(phenylcarbamoyl)propionic Acid |
| Lg-Weinsaeure-monoanilid |
| N-Phenyl-Lg-tartramidsaeure |
| N-Phenyl-d-tartramidsaeure |
| (2R,3R)-Tartranilic Acid |
| Lg-Tartranilsaeure |