ALLOTETRAHYDROCORTISOL
ALLOTETRAHYDROCORTISOL structure
|
Common Name | ALLOTETRAHYDROCORTISOL | ||
|---|---|---|---|---|
| CAS Number | 302-91-0 | Molecular Weight | 366.49200 | |
| Density | 1.253g/cm3 | Boiling Point | 545.1ºC at 760mmHg | |
| Molecular Formula | C21H34O5 | Melting Point | 244.5ºC | |
| MSDS | N/A | Flash Point | 297.6ºC | |
Use of ALLOTETRAHYDROCORTISOLAllotetrahydrocortisol (5a-Tetrahydrocortisol) is a metabolite of Cortisol. Cortisol is the main glucocorticoid in human. It is produced in adrenal cortex and plays a crucial role in many physiological processes[1][2]. |
Summary: Allopregnane-3.α.,11.β.,17.α.,21-tetrol-20-one (ALLOTETRAHYDROCORTISOL) is a metabolite of Cortisol, the main glucocorticoid in humans, produced in the adrenal cortex and involved in various physiological processes. CAS number: 302-91-0, molecular formula: C21H34O5, molecular weight: 366.49200. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Allopregnane-3.α.,11.β.,17.α.,21-tetrol-20-one |
|---|---|
| Synonym | More Synonyms |
This table contains bioactivity, target information and biological‑assay experimental data of this compound.
| Description | Allotetrahydrocortisol (5a-Tetrahydrocortisol) is a metabolite of Cortisol. Cortisol is the main glucocorticoid in human. It is produced in adrenal cortex and plays a crucial role in many physiological processes[1][2]. |
|---|---|
| Related Catalog | |
| Target |
Human Endogenous Metabolite |
| In Vitro | Allotetrahydrocortisol (5a-Tetrahydrocortisol) is a natural C21 steroid of animal origin, and has the axial configuration of its 3-hydroxyl group[1]. |
| References |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.253g/cm3 |
|---|---|
| Boiling Point | 545.1ºC at 760mmHg |
| Melting Point | 244.5ºC |
| Molecular Formula | C21H34O5 |
| Molecular Weight | 366.49200 |
| Flash Point | 297.6ºC |
| Exact Mass | 366.24100 |
| PSA | 97.99000 |
| LogP | 1.65330 |
| Index of Refraction | 1.579 |
| InChIKey | AODPIQQILQLWGS-FDSHTENPSA-N |
| SMILES | CC12CCC(O)CC1CCC1C2C(O)CC2(C)C1CCC2(O)C(=O)CO |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~97%
ALLOTETRAHYDROC... CAS#:302-91-0 |
| Literature: Okihara, Rika; Mitamura, Kuniko; Hasegawa, Maki; Mori, Megumi; Muto, Akina; Kakiyama, Genta; Ogawa, Shoujiro; Iida, Takashi; Shimada, Miki; Mano, Nariyasu; Ikegawa, Shigeo Chemical and Pharmaceutical Bulletin, 2010 , vol. 58, # 3 p. 344 - 353 |
|
~%
ALLOTETRAHYDROC... CAS#:302-91-0 |
| Literature: Journal of Organic Chemistry, , vol. 24, p. 669,672 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| KENDALL'S COMPOUND 'C' |
| Allotetrahydrocortisol |
| ALLO THF |
| 5a-Tetrahydrocortisol |
| REICHSTEIN'S SUBSTANCE 'C' |
| KENDALL'S COMPUND ''C'' |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of Allopregnane-3.α.,11.β.,17.α.,21-tetrol-20-one? |
| A: LogP of Allopregnane-3.α.,11.β.,17.α.,21-tetrol-20-one is 1.65330. |
| Q: What is the SMILES notation of Allopregnane-3.α.,11.β.,17.α.,21-tetrol-20-one? |
| A: SMILES notation of Allopregnane-3.α.,11.β.,17.α.,21-tetrol-20-one is CC12CCC(O)CC1CCC1C2C(O)CC2(C)C1CCC2(O)C(=O)CO. |
| Q: What is the polar surface area (PSA) of Allopregnane-3.α.,11.β.,17.α.,21-tetrol-20-one? |
| A: Polar surface area (PSA) of Allopregnane-3.α.,11.β.,17.α.,21-tetrol-20-one is 97.99000. |
| Q: What English synonyms does Allopregnane-3.α.,11.β.,17.α.,21-tetrol-20-one have? |
| A: English synonyms of Allopregnane-3.α.,11.β.,17.α.,21-tetrol-20-one: KENDALL'S COMPOUND 'C', Allotetrahydrocortisol, ALLO THF, 5a-Tetrahydrocortisol, REICHSTEIN'S SUBSTANCE 'C', KENDALL'S COMPUND ''C''. |
| Q: What is the boiling point of Allopregnane-3.α.,11.β.,17.α.,21-tetrol-20-one? |
| A: Boiling point of Allopregnane-3.α.,11.β.,17.α.,21-tetrol-20-one is 545.1ºC at 760mmHg. |
| Q: What is the molecular weight of Allopregnane-3.α.,11.β.,17.α.,21-tetrol-20-one? |
| A: Molecular weight of Allopregnane-3.α.,11.β.,17.α.,21-tetrol-20-one is 366.49200. |
| Q: What is the melting point of Allopregnane-3.α.,11.β.,17.α.,21-tetrol-20-one? |
| A: Melting point of Allopregnane-3.α.,11.β.,17.α.,21-tetrol-20-one is 244.5ºC. |
| Q: What is the InChIKey of Allopregnane-3.α.,11.β.,17.α.,21-tetrol-20-one? |
| A: InChIKey of Allopregnane-3.α.,11.β.,17.α.,21-tetrol-20-one is AODPIQQILQLWGS-FDSHTENPSA-N. |
| Q: What are the uses of Allopregnane-3.α.,11.β.,17.α.,21-tetrol-20-one? |
| A: Main uses of Allopregnane-3.α.,11.β.,17.α.,21-tetrol-20-one: Allotetrahydrocortisol (5a-Tetrahydrocortisol) is a metabolite of Cortisol. Cortisol is the main glucocorticoid in human. It is produced in adrenal cortex and plays a crucial role in many physiological processes[1][2]. |
| Q: What is the molecular formula of Allopregnane-3.α.,11.β.,17.α.,21-tetrol-20-one? |
| A: Molecular formula of Allopregnane-3.α.,11.β.,17.α.,21-tetrol-20-one is C21H34O5. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |