Inosine, 6-thio-,2',3',5'-triacetate structure
|
Common Name | Inosine, 6-thio-,2',3',5'-triacetate | ||
|---|---|---|---|---|
| CAS Number | 3021-21-4 | Molecular Weight | 410.40200 | |
| Density | 1.61g/cm3 | Boiling Point | 622.3ºC at 760mmHg | |
| Molecular Formula | C16H18N4O7S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 330.1ºC | |
| Name | 9H-Purine-6-thiol, 9-.β.-D-ribofuranosyl-, 2',3',5'-triacetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.61g/cm3 |
|---|---|
| Boiling Point | 622.3ºC at 760mmHg |
| Molecular Formula | C16H18N4O7S |
| Molecular Weight | 410.40200 |
| Flash Point | 330.1ºC |
| Exact Mass | 410.09000 |
| PSA | 166.72000 |
| LogP | 0.81280 |
| Index of Refraction | 1.688 |
| InChIKey | MENHRYRSGYYUJA-XNIJJKJLSA-N |
| SMILES | CC(=O)OCC1OC(n2cnc3c(=S)nc[nH]c32)C(OC(C)=O)C1OC(C)=O |
|
~79%
Inosine, 6-thio... CAS#:3021-21-4 |
| Literature: Sa, Marcus Mandolesi; Meier, Lidiane Synlett, 2006 , # 20 p. 3474 - 3478 |
|
~%
Inosine, 6-thio... CAS#:3021-21-4 |
| Literature: Ellermann, Manuel; Paulini, Ralph; Jakob-Roetne, Roland; Lerner, Christian; Borroni, Edilio; Roth, Doris; Ehler, Andreas; Schweizer, W. Bernd; Schlatter, Daniel; Rudolph, Markus G.; Diederich, Francois Chemistry - A European Journal, 2011 , vol. 17, # 23 p. 6369 - 6381 |
|
~%
Inosine, 6-thio... CAS#:3021-21-4 |
| Literature: Meier, Lidiane; Monteiro, Gustavo C.; Baldissera, Rodrigo A.M.; Sa, Marcus Mandolesi Journal of the Brazilian Chemical Society, 2010 , vol. 21, # 5 p. 859 - 866 |
| Precursor 5 | |
|---|---|
| DownStream 6 | |
| 2',3',5'-tri-O-acetyl-6-thioinosine |
| Einecs 221-169-9 |
| O2',O3',O5'-triacetyl-6-thio-inosine |
| 6-mercaptopurine riboside triacetate |
| 6-thioinosine 2',3',5'-triacetate |
| 2',3',5'-Tri-O-acetyl-thioinosin |
| Tri-O-acetyl-thioinosin |