Arenobufagin 3-hemisuberate structure
|
Common Name | Arenobufagin 3-hemisuberate | ||
|---|---|---|---|---|
| CAS Number | 30219-16-0 | Molecular Weight | 572.68600 | |
| Density | 1.30±0.1 g/cm3(Predicted) | Boiling Point | 754.4±60.0 °C(Predicted) | |
| Molecular Formula | C32H44O9 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Arenobufagin 3-hemisuberateArenobufagin 3-hemisuberate is a natural compound as a cardiotonic steroid isolated from the skin of Japanese toad[1]. |
| Name | Arenobufagin-3-hemisuberat |
|---|---|
| Synonym | More Synonyms |
| Description | Arenobufagin 3-hemisuberate is a natural compound as a cardiotonic steroid isolated from the skin of Japanese toad[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.30±0.1 g/cm3(Predicted) |
|---|---|
| Boiling Point | 754.4±60.0 °C(Predicted) |
| Molecular Formula | C32H44O9 |
| Molecular Weight | 572.68600 |
| Exact Mass | 572.29900 |
| PSA | 151.34000 |
| LogP | 4.36780 |
| InChIKey | LYCCSNYEMCXNRM-QCTKBPTFSA-N |
| SMILES | CC12CCC(OC(=O)CCCCCCC(=O)O)CC1CCC1C2C(O)C(=O)C2(C)C(c3ccc(=O)oc3)CCC12O |
| Arenobufagin 3-hemisuberate |