Ethanone, 1-phenyl-,O-[(diethylamino)carbonyl]oxime (9CI) structure
|
Common Name | Ethanone, 1-phenyl-,O-[(diethylamino)carbonyl]oxime (9CI) | ||
|---|---|---|---|---|
| CAS Number | 30289-16-8 | Molecular Weight | 234.29400 | |
| Density | 1.01g/cm3 | Boiling Point | 316.9ºC at 760mmHg | |
| Molecular Formula | C13H18N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 145.5ºC | |
| Name | [(Z)-1-phenylethylideneamino] N,N-diethylcarbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.01g/cm3 |
|---|---|
| Boiling Point | 316.9ºC at 760mmHg |
| Molecular Formula | C13H18N2O2 |
| Molecular Weight | 234.29400 |
| Flash Point | 145.5ºC |
| Exact Mass | 234.13700 |
| PSA | 41.90000 |
| LogP | 2.88900 |
| Index of Refraction | 1.508 |
| InChIKey | BZBPWTBCIURBLV-SDNWHVSQSA-N |
| SMILES | CCN(CC)C(=O)ON=C(C)c1ccccc1 |
|
~%
Ethanone, 1-phe... CAS#:30289-16-8 |
| Literature: McBurney, Roy T.; Walton, John C. Journal of the American Chemical Society, 2013 , vol. 135, # 19 p. 7349 - 7354 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| acetophenone N,N-diethylcarbamoyl oxime |