RH01687 structure
|
Common Name | RH01687 | ||
|---|---|---|---|---|
| CAS Number | 302901-13-9 | Molecular Weight | 336.76 | |
| Density | 1.8±0.1 g/cm3 | Boiling Point | 628.6±65.0 °C at 760 mmHg | |
| Molecular Formula | C12H9ClN6O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 334.0±34.3 °C | |
Use of RH01687RH01687 is a compound that can protect pancreatic β cells against endoplasmic reticulum stress-induced cell death. RH01687 has the potential for the research of diabetes[1]. |
| Name | 5-{[4-chloro-2-nitro-5-(1H-pyrrol-1-yl)phenyl]thio}-4H-1,2,4-triazol-3-amine |
|---|---|
| Synonym | More Synonyms |
| Description | RH01687 is a compound that can protect pancreatic β cells against endoplasmic reticulum stress-induced cell death. RH01687 has the potential for the research of diabetes[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.8±0.1 g/cm3 |
|---|---|
| Boiling Point | 628.6±65.0 °C at 760 mmHg |
| Molecular Formula | C12H9ClN6O2S |
| Molecular Weight | 336.76 |
| Flash Point | 334.0±34.3 °C |
| Exact Mass | 336.019623 |
| LogP | 3.51 |
| Vapour Pressure | 0.0±1.8 mmHg at 25°C |
| Index of Refraction | 1.821 |
| InChIKey | BOVTVNWNYFQVMI-UHFFFAOYSA-N |
| SMILES | Nc1nc(Sc2cc(-n3cccc3)c(Cl)cc2[N+](=O)[O-])n[nH]1 |
| Storage condition | -20°C |
| 1H-1,2,4-Triazol-5-amine, 3-[[4-chloro-2-nitro-5-(1H-pyrrol-1-yl)phenyl]thio]- |
| 5-{[4-chloro-2-nitro-5-(1H-pyrrol-1-yl)phenyl]thio}-4H-1,2,4-triazol-3-amine |
| 3-{[4-Chloro-2-nitro-5-(1H-pyrrol-1-yl)phenyl]sulfanyl}-1H-1,2,4-triazol-5-amine |