Atocalcitol structure
|
Common Name | Atocalcitol | ||
|---|---|---|---|---|
| CAS Number | 302904-82-1 | Molecular Weight | 494.70500 | |
| Density | 1.12g/cm3 | Boiling Point | 636.3ºC at 760mmHg | |
| Molecular Formula | C32H46O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 338.6ºC | |
Use of AtocalcitolAtocalcitol, a vitamin D3 analogue, is used in the study for psoriasis[1]. |
| Name | (1R,3S,5Z)-5-[(2E)-2-[(1R,3aS,7aR)-1-[(2R)-1-[[3-(2-hydroxypropan-2-yl)phenyl]methoxy]propan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexane-1,3-diol |
|---|---|
| Synonym | More Synonyms |
| Description | Atocalcitol, a vitamin D3 analogue, is used in the study for psoriasis[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.12g/cm3 |
|---|---|
| Boiling Point | 636.3ºC at 760mmHg |
| Molecular Formula | C32H46O4 |
| Molecular Weight | 494.70500 |
| Flash Point | 338.6ºC |
| Exact Mass | 494.34000 |
| PSA | 69.92000 |
| LogP | 6.20770 |
| Index of Refraction | 1.579 |
| InChIKey | CFIFSLBCJAXYTC-FJLAUVHZSA-N |
| SMILES | C=C1C(=CC=C2CCCC3(C)C2CCC3C(C)COCc2cccc(C(C)(C)O)c2)CC(O)CC1O |
| UNII-PR3292R3H7 |
| Atocalcitol |
| Atocalcitol [INN] |
| Atocalcitolum |
| Atocalcitolum [INN-Latin] |
| (1S,3R,5Z,7E,20R)-20-(3-(2-Hydroxypropan-2-yl)benzyloxymethyl)-9,10-secopregna-5,7,10(19)-triene-1alpha,3beta-diol |